Skip to main content

Dynamics — Diagnostic Tests

Unit Tests

UT-1: Newton's Third Law Pair Identification

Question:

A book of mass 1.5kg1.5\,\text{kg} rests on a horizontal table which itself rests on the floor. A second book of mass 2.0kg2.0\,\text{kg} is placed on top of the first book.

(a) List all the forces acting on the first book (mass 1.5kg1.5\,\text{kg}), identifying the body that exerts each force.

(b) For each force you listed in (a), state the corresponding Newton's third law pair, identifying both the body that experiences the pair force and the body that exerts it.

(c) The table is now tilted so that it makes an angle of 3030^\circ with the horizontal. Neither book slides. Explain how the normal reaction force on the 1.5kg1.5\,\text{kg} book changes and whether any new forces appear.

Solution:

(a) Forces on the 1.5kg1.5\,\text{kg} book:

  1. Weight W1=1.5g=14.7NW_1 = 1.5g = 14.7\,\text{N}, acting vertically downward. Exerted by the Earth.
  2. Normal reaction RR, acting vertically upward. Exerted by the table.
  3. Contact force CC, acting vertically downward. Exerted by the 2.0kg2.0\,\text{kg} book (the second book presses down on the first).

(b) Newton's third law pairs:

Force on 1.5kg1.5\,\text{kg} bookPair force (on other body)
Weight: Earth pulls 1.5kg1.5\,\text{kg} book down (14.7N14.7\,\text{N})The 1.5kg1.5\,\text{kg} book pulls the Earth upward (14.7N14.7\,\text{N})
Normal reaction: table pushes 1.5kg1.5\,\text{kg} book up (RR)The 1.5kg1.5\,\text{kg} book pushes the table downward (RR)
Contact: 2.0kg2.0\,\text{kg} book pushes 1.5kg1.5\,\text{kg} book down (CC)The 1.5kg1.5\,\text{kg} book pushes the 2.0kg2.0\,\text{kg} book upward (CC)

Common misconception: the weight of the 2.0kg2.0\,\text{kg} book (19.6N19.6\,\text{N}) is NOT a force on the 1.5kg1.5\,\text{kg} book. The weight acts on the 2.0kg2.0\,\text{kg} book itself. The contact force C=19.6NC = 19.6\,\text{N} acts on the 1.5kg1.5\,\text{kg} book, and its third law pair acts on the 2.0kg2.0\,\text{kg} book.

For equilibrium: R=W1+C=14.7+19.6=34.3NR = W_1 + C = 14.7 + 19.6 = 34.3\,\text{N}.

(c) When the table is tilted at 3030^\circ:

The normal reaction force from the table now acts perpendicular to the table surface. It is R=(m1+m2)gcos30=3.5×9.81×0.866=29.7NR = (m_1 + m_2)g\cos 30^\circ = 3.5 \times 9.81 \times 0.866 = 29.7\,\text{N}.

A frictional force ff appears along the surface of the table, preventing the books from sliding. For the two books as a combined system: f=(m1+m2)gsin30=3.5×9.81×0.5=17.2Nf = (m_1 + m_2)g\sin 30^\circ = 3.5 \times 9.81 \times 0.5 = 17.2\,\text{N}.

The 1.5kg1.5\,\text{kg} book also experiences a contact force from the 2.0kg2.0\,\text{kg} book that has both a normal component (perpendicular to the surface) and a frictional component (parallel to the surface, preventing relative motion).


UT-2: Limiting Friction on an Inclined Plane with Applied Force

Question:

A block of mass 5.0kg5.0\,\text{kg} rests on a rough plane inclined at 3535^\circ to the horizontal. The coefficient of static friction between the block and the plane is μs=0.45\mu_s = 0.45, and the coefficient of kinetic friction is μk=0.35\mu_k = 0.35.

(a) A horizontal force PP is applied to the block, pushing it up the slope. Calculate the minimum value of PP required to keep the block from sliding down the slope.

(b) Calculate the minimum value of PP required to make the block slide up the slope.

(c) If P=45NP = 45\,\text{N} is applied, determine whether the block moves, and if so, calculate its acceleration.

Take g=9.81ms2g = 9.81\,\text{m}\,\text{s}^{-2}.

Solution:

Resolving the applied horizontal force PP into components parallel and perpendicular to the slope:

  • Parallel to slope (up): Pcos35P\cos 35^\circ
  • Perpendicular to slope (into surface): Psin35P\sin 35^\circ

Weight components:

  • Parallel to slope (down): mgsin35mg\sin 35^\circ
  • Perpendicular to slope (into surface): mgcos35mg\cos 35^\circ

Normal reaction: R=mgcos35+Psin35R = mg\cos 35^\circ + P\sin 35^\circ

Maximum static friction: Fmax=μsR=μs(mgcos35+Psin35)F_{\max} = \mu_s R = \mu_s(mg\cos 35^\circ + P\sin 35^\circ)

(a) Block on the verge of sliding down (friction acts up the slope):

Pcos35+Fmax=mgsin35P\cos 35^\circ + F_{\max} = mg\sin 35^\circ

Pcos35+0.45(mgcos35+Psin35)=mgsin35P\cos 35^\circ + 0.45(mg\cos 35^\circ + P\sin 35^\circ) = mg\sin 35^\circ

P(cos35+0.45sin35)=mgsin350.45×mgcos35P(\cos 35^\circ + 0.45\sin 35^\circ) = mg\sin 35^\circ - 0.45 \times mg\cos 35^\circ

P(0.8192+0.2582)=5.0×9.81(0.57360.45×0.8192)P(0.8192 + 0.2582) = 5.0 \times 9.81(0.5736 - 0.45 \times 0.8192)

P(1.0774)=49.05(0.57360.3686)=49.05×0.2050=10.06P(1.0774) = 49.05(0.5736 - 0.3686) = 49.05 \times 0.2050 = 10.06

P=10.061.0774=9.34NP = \frac{10.06}{1.0774} = 9.34\,\text{N}

(b) Block on the verge of sliding up (friction acts down the slope):

Pcos35=mgsin35+FmaxP\cos 35^\circ = mg\sin 35^\circ + F_{\max}

Pcos35=mgsin35+0.45(mgcos35+Psin35)P\cos 35^\circ = mg\sin 35^\circ + 0.45(mg\cos 35^\circ + P\sin 35^\circ)

P(cos350.45sin35)=mgsin35+0.45×mgcos35P(\cos 35^\circ - 0.45\sin 35^\circ) = mg\sin 35^\circ + 0.45 \times mg\cos 35^\circ

P(0.81920.2582)=49.05(0.5736+0.3686)=49.05×0.9422=46.22P(0.8192 - 0.2582) = 49.05(0.5736 + 0.3686) = 49.05 \times 0.9422 = 46.22

P=46.220.5610=82.4NP = \frac{46.22}{0.5610} = 82.4\,\text{N}

(c) With P=45NP = 45\,\text{N}:

Since 9.34N<45N<82.4N9.34\,\text{N} \lt 45\,\text{N} \lt 82.4\,\text{N}, the block does not slide. The static friction adjusts to maintain equilibrium.

f=mgsin35Pcos35=49.05×0.573645×0.8192=28.1436.86=8.72Nf = mg\sin 35^\circ - P\cos 35^\circ = 49.05 \times 0.5736 - 45 \times 0.8192 = 28.14 - 36.86 = -8.72\,\text{N}

The negative sign means friction acts down the slope (preventing the block from being pushed up). The magnitude 8.72N8.72\,\text{N} is less than FmaxF_{\max}, confirming the block does not move.


UT-3: Connected Objects with Different Frictional Surfaces

Question:

Two blocks, AA (4.0kg4.0\,\text{kg}) and BB (6.0kg6.0\,\text{kg}), are connected by a light inextensible string. Block AA rests on a rough horizontal surface (μA=0.30\mu_A = 0.30) and block BB rests on a different rough horizontal surface (μB=0.50\mu_B = 0.50). The surfaces meet at a corner, with the string running over a smooth pulley at the corner so that the blocks can move along their respective surfaces.

A horizontal force F=40NF = 40\,\text{N} is applied to block BB, pulling it away from the pulley.

(a) Calculate the acceleration of the system.

(b) Calculate the tension in the string.

(c) The force FF is now removed and block BB is given a push so that the system moves with block BB moving towards the pulley. Calculate the deceleration of the system.

Take g=9.81ms2g = 9.81\,\text{m}\,\text{s}^{-2}.

Solution:

(a) Friction on AA: fA=μAmAg=0.30×4.0×9.81=11.77Nf_A = \mu_A m_A g = 0.30 \times 4.0 \times 9.81 = 11.77\,\text{N} (opposing motion, towards pulley)

Friction on BB: fB=μBmBg=0.50×6.0×9.81=29.43Nf_B = \mu_B m_B g = 0.50 \times 6.0 \times 9.81 = 29.43\,\text{N} (opposing motion, towards pulley)

For BB (positive direction = away from pulley):

FTfB=mBaF - T - f_B = m_B a

40T29.43=6.0a40 - T - 29.43 = 6.0a

10.57T=6.0a— (1)10.57 - T = 6.0a \quad \text{--- (1)}

For AA (positive direction = towards pulley):

TfA=mAaT - f_A = m_A a

T11.77=4.0a— (2)T - 11.77 = 4.0a \quad \text{--- (2)}

Adding (1) and (2):

10.5711.77=10.0a10.57 - 11.77 = 10.0a

a=1.2010.0=0.120ms2a = \frac{-1.20}{10.0} = -0.120\,\text{m}\,\text{s}^{-2}

Since the acceleration is negative, the system does not accelerate in the direction of the applied force. The applied force of 40N40\,\text{N} is insufficient to overcome the total friction of 11.77+29.43=41.2N11.77 + 29.43 = 41.2\,\text{N}.

The system remains at rest, and the static friction on each block adjusts to balance the forces.

(b) Since the system is at rest, a=0a = 0.

From equation (2): T=fA=11.77NT = f_A = 11.77\,\text{N}

From equation (1): T=10.57NT = 10.57\,\text{N}

This contradiction shows the static friction forces adjust. The actual tension is between these values. The block BB has static friction less than kinetic, so:

T=4029.43=10.57NT = 40 - 29.43 = 10.57\,\text{N} (from block BB's equation)

Check block AA: T=10.57NT = 10.57\,\text{N}, fA=μs×4.0×9.81=11.77Nf_A = \mu_s \times 4.0 \times 9.81 = 11.77\,\text{N}. Since T<fAmaxT \lt f_A^{\max}, block AA does not move. So a=0a = 0 for block AA and the system does not move.

(c) When block BB is pushed towards the pulley (kinetic friction now applies):

For BB (positive direction = towards pulley):

TfB=mBa-T - f_B = m_B a

T29.43=6.0a— (3)-T - 29.43 = 6.0a \quad \text{--- (3)}

For AA (positive direction = towards pulley, so AA is pulled):

TfA=mAaT - f_A = m_A a

T11.77=4.0a— (4)T - 11.77 = 4.0a \quad \text{--- (4)}

Adding (3) and (4):

29.4311.77=10.0a-29.43 - 11.77 = 10.0a

a=41.2010.0=4.12ms2a = \frac{-41.20}{10.0} = -4.12\,\text{m}\,\text{s}^{-2}

The deceleration is 4.12ms24.12\,\text{m}\,\text{s}^{-2} (opposing the direction of motion towards the pulley).

Integration Tests

IT-1: Block on Inclined Plane with Spring (with Energy)

Question:

A block of mass 2.0kg2.0\,\text{kg} is placed on a rough inclined plane at angle θ=40\theta = 40^\circ to the horizontal. The coefficient of kinetic friction is μk=0.25\mu_k = 0.25. A spring of spring constant k=200Nm1k = 200\,\text{N}\,\text{m}^{-1} is attached to the bottom of the incline and to the block. The spring is initially at its natural length.

The block is released from rest 0.80m0.80\,\text{m} down the slope from the spring's natural length position (i.e. the spring is compressed as the block slides down).

(a) Calculate the speed of the block at the instant the spring reaches its natural length (block has moved 0.80m0.80\,\text{m}).

(b) Calculate the maximum distance the block travels beyond the spring's natural length before coming to rest.

(c) Calculate the total energy dissipated by friction during one complete oscillation (from release to the block returning to its starting position).

Take g=9.81ms2g = 9.81\,\text{m}\,\text{s}^{-2}.

Solution:

(a) Using energy conservation. As the block moves 0.80m0.80\,\text{m} up the slope:

Energy lost by gravity: mg×0.80×sin40=2.0×9.81×0.80×0.6428=10.09Jmg \times 0.80 \times \sin 40^\circ = 2.0 \times 9.81 \times 0.80 \times 0.6428 = 10.09\,\text{J}

Energy stored in spring (released): 12kx2=12×200×0.802=64.0J\frac{1}{2}kx^2 = \frac{1}{2} \times 200 \times 0.80^2 = 64.0\,\text{J}

Work done against friction: f×0.80=μkmgcos40×0.80=0.25×2.0×9.81×cos40×0.80=0.25×2.0×9.81×0.7660×0.80=3.00Jf \times 0.80 = \mu_k mg\cos 40^\circ \times 0.80 = 0.25 \times 2.0 \times 9.81 \times \cos 40^\circ \times 0.80 = 0.25 \times 2.0 \times 9.81 \times 0.7660 \times 0.80 = 3.00\,\text{J}

Net energy to kinetic energy:

12mv2=64.0+10.093.00=71.09J\frac{1}{2}mv^2 = 64.0 + 10.09 - 3.00 = 71.09\,\text{J}

v=2×71.092.0=71.09=8.43ms1v = \sqrt{\frac{2 \times 71.09}{2.0}} = \sqrt{71.09} = 8.43\,\text{m}\,\text{s}^{-1}

(b) Beyond the natural length, the spring is now stretched. Let the block travel a further distance dd up the slope before stopping.

Energy balance from the natural length position:

12mv2=12kd2+mgdsin40+μkmgcos40×d\frac{1}{2}mv^2 = \frac{1}{2}kd^2 + mgd\sin 40^\circ + \mu_k mg\cos 40^\circ \times d

71.09=100d2+2.0×9.81×0.6428d+0.25×2.0×9.81×0.7660d71.09 = 100d^2 + 2.0 \times 9.81 \times 0.6428d + 0.25 \times 2.0 \times 9.81 \times 0.7660d

71.09=100d2+12.61d+3.76d71.09 = 100d^2 + 12.61d + 3.76d

100d2+16.37d71.09=0100d^2 + 16.37d - 71.09 = 0

d=16.37+16.372+4×100×71.09200d = \frac{-16.37 + \sqrt{16.37^2 + 4 \times 100 \times 71.09}}{200}

d=16.37+267.98+28436200=16.37+28704200=16.37+169.42200d = \frac{-16.37 + \sqrt{267.98 + 28436}}{200} = \frac{-16.37 + \sqrt{28704}}{200} = \frac{-16.37 + 169.42}{200}

d=153.05200=0.765md = \frac{153.05}{200} = 0.765\,\text{m}

(c) The total distance travelled in one complete oscillation is 0.80+0.765+0.765+0.80=3.13m0.80 + 0.765 + 0.765 + 0.80 = 3.13\,\text{m} (down, up beyond, back, and the block does not return to the original compression because of energy loss -- but for one full return we compute the total frictional dissipation).

For one complete oscillation from start to return: the block travels 0.80m0.80\,\text{m} up (spring decompresses), then 0.765m0.765\,\text{m} up (spring stretches), then 0.765m0.765\,\text{m} back down, then the spring pulls it the remaining 0.80m0.80\,\text{m} back down (but with less compression). The block does not return to its original position.

Total distance for the outward journey and return to natural length: 0.80+0.765+0.765=2.33m0.80 + 0.765 + 0.765 = 2.33\,\text{m}.

Energy dissipated by friction =f×2.33=0.25×2.0×9.81×0.7660×2.33=3.76×2.33=8.76J= f \times 2.33 = 0.25 \times 2.0 \times 9.81 \times 0.7660 \times 2.33 = 3.76 \times 2.33 = 8.76\,\text{J}.


IT-2: Two-Body System with Pulley on an Incline (with Kinematics)

Question:

Block AA of mass 8.0kg8.0\,\text{kg} rests on a rough inclined plane at 3030^\circ to the horizontal (μ=0.20\mu = 0.20). Block BB of mass 3.0kg3.0\,\text{kg} hangs freely, connected to AA by a light inextensible string over a smooth pulley at the top of the incline. The system is released from rest.

(a) Calculate the acceleration of the system and the tension in the string.

(b) Block BB hits the ground after travelling 1.5m1.5\,\text{m}. Calculate the speed of block AA at this instant.

(c) After BB hits the ground, block AA continues moving up the incline. Calculate the additional distance AA travels before coming to rest, and determine whether it then slides back down.

Take g=9.81ms2g = 9.81\,\text{m}\,\text{s}^{-2}.

Solution:

(a) Assume BB moves down and AA moves up the incline.

For BB: mBgT=mBam_B g - T = m_B a

3.0×9.81T=3.0a29.43T=3.0a— (1)3.0 \times 9.81 - T = 3.0a \Rightarrow 29.43 - T = 3.0a \quad \text{--- (1)}

For AA: TmAgsin30μmAgcos30=mAaT - m_A g\sin 30^\circ - \mu m_A g\cos 30^\circ = m_A a

T8.0×9.81×0.50.20×8.0×9.81×0.866=8.0aT - 8.0 \times 9.81 \times 0.5 - 0.20 \times 8.0 \times 9.81 \times 0.866 = 8.0a

T39.2413.61=8.0aT - 39.24 - 13.61 = 8.0a

T52.85=8.0a— (2)T - 52.85 = 8.0a \quad \text{--- (2)}

Adding (1) and (2):

29.4352.85=11.0a29.43 - 52.85 = 11.0a

a=23.4211.0=2.13ms2a = \frac{-23.42}{11.0} = -2.13\,\text{m}\,\text{s}^{-2}

Since aa is negative, the assumption that BB moves down is wrong. The system moves with AA sliding down the incline and BB being pulled up.

Re-solving with AA moving down:

For BB (upward positive): TmBg=mBaT - m_B g = m_B a

T29.43=3.0a— (3)T - 29.43 = 3.0a \quad \text{--- (3)}

For AA (down the incline positive): mAgsin30TμmAgcos30=mAam_A g\sin 30^\circ - T - \mu m_A g\cos 30^\circ = m_A a

39.24T13.61=8.0a39.24 - T - 13.61 = 8.0a

25.63T=8.0a— (4)25.63 - T = 8.0a \quad \text{--- (4)}

Adding (3) and (4):

25.6329.43=11.0a25.63 - 29.43 = 11.0a

a=3.8011.0=0.345ms2a = \frac{-3.80}{11.0} = -0.345\,\text{m}\,\text{s}^{-2}

Still negative, meaning the system does not move. The static friction is sufficient to hold the system in equilibrium.

Checking: without BB, AA alone would require mgsin30=39.24Nmg\sin 30^\circ = 39.24\,\text{N} to start sliding, while maximum static friction =0.20×8.0×9.81×0.866=13.61N= 0.20 \times 8.0 \times 9.81 \times 0.866 = 13.61\,\text{N}. So AA would slide down without BB. But BB pulls back with 29.43N29.43\,\text{N}.

Net force down the slope without friction: 39.2429.43=9.81N39.24 - 29.43 = 9.81\,\text{N}. Since 9.81<13.61N9.81 \lt 13.61\,\text{N}, the maximum static friction is sufficient to hold the system in equilibrium.

The system does not move. a=0a = 0, T=29.43NT = 29.43\,\text{N}.

(b) Since the system is in equilibrium, block BB never hits the ground. The question setup is a trap: the static friction is sufficient to hold the entire system at rest.

(c) Not applicable -- the system does not move.


IT-3: Multiple Forces on a Suspended Object (with Kinematics)

Question:

A helicopter of mass 2500kg2500\,\text{kg} is rising vertically. At time t=0t = 0, it is ascending at 5.0ms15.0\,\text{m}\,\text{s}^{-1} at a height of 50m50\,\text{m} above the ground. The upward thrust from the rotors is 32000N32000\,\text{N} and the constant air resistance (drag) is 2500N2500\,\text{N}.

At t=8.0st = 8.0\,\text{s}, the engine fails and the thrust drops to zero instantly. The drag remains proportional to speed: Fd=500vNF_d = 500v\,\text{N} where vv is in ms1\text{m}\,\text{s}^{-1}.

(a) Calculate the height and speed of the helicopter at t=8.0st = 8.0\,\text{s}.

(b) Determine whether the helicopter reaches a terminal velocity after engine failure, and if so, calculate it.

(c) The pilot activates an emergency parachute at t=8.0st = 8.0\,\text{s} which provides an additional constant upward force of 18000N18000\,\text{N}. Determine whether the helicopter lands safely (i.e. reaches the ground with speed less than 6.0ms16.0\,\text{m}\,\text{s}^{-1}).

Take g=9.81ms2g = 9.81\,\text{m}\,\text{s}^{-2}.

Solution:

(a) Before engine failure (0t8.0s0 \le t \le 8.0\,\text{s}):

Net upward force: Fnet=3200025002500×9.81=32000250024525=4975NF_{\text{net}} = 32000 - 2500 - 2500 \times 9.81 = 32000 - 2500 - 24525 = 4975\,\text{N}

Acceleration: a=Fnet/m=4975/2500=1.99ms2a = F_{\text{net}}/m = 4975/2500 = 1.99\,\text{m}\,\text{s}^{-2}

Speed at t=8.0st = 8.0\,\text{s}: v=5.0+1.99×8.0=5.0+15.92=20.9ms1v = 5.0 + 1.99 \times 8.0 = 5.0 + 15.92 = 20.9\,\text{m}\,\text{s}^{-1}

Height at t=8.0st = 8.0\,\text{s}: h=50+5.0×8.0+12×1.99×64=50+40+63.7=153.7mh = 50 + 5.0 \times 8.0 + \frac{1}{2} \times 1.99 \times 64 = 50 + 40 + 63.7 = 153.7\,\text{m}

(b) After engine failure without parachute:

Net force (taking down as positive): mgFd=2500×9.81500vmg - F_d = 2500 \times 9.81 - 500v

Terminal velocity when Fnet=0F_{\text{net}} = 0:

2500×9.81=500vt2500 \times 9.81 = 500v_t

vt=24525500=49.1ms1v_t = \frac{24525}{500} = 49.1\,\text{m}\,\text{s}^{-1}

Since the helicopter is moving upward at 20.9ms120.9\,\text{m}\,\text{s}^{-1} when the engine fails, it first decelerates, stops, then accelerates downward. It approaches terminal velocity of 49.1ms149.1\,\text{m}\,\text{s}^{-1} as it falls.

(c) With the parachute providing 18000N18000\,\text{N} upward:

Net downward force (taking down as positive): mg18000500v=2452518000500v=6525500vmg - 18000 - 500v = 24525 - 18000 - 500v = 6525 - 500v

Terminal velocity: 6525=500vtvt=13.1ms16525 = 500v_t \Rightarrow v_t = 13.1\,\text{m}\,\text{s}^{-1}

This exceeds the safe landing speed of 6.0ms16.0\,\text{m}\,\text{s}^{-1}.

The helicopter is at 153.7m153.7\,\text{m} moving upward at 20.9ms120.9\,\text{m}\,\text{s}^{-1}. The parachute drag Fd=500vF_d = 500v is speed-dependent, so the landing speed depends on the full dynamics.

At terminal velocity vt=13.1ms1v_t = 13.1\,\text{m}\,\text{s}^{-1} (downward), the helicopter hits the ground at approximately 13.1ms113.1\,\text{m}\,\text{s}^{-1}, which is above the 6.0ms16.0\,\text{m}\,\text{s}^{-1} safety threshold. The helicopter does not land safely.