Skip to main content

Trigonometry

Radian Measure

Definition

The radian is the standard unit of angular measure. An angle θ\theta in radians is defined as the ratio of the arc length ss subtended by the angle to the radius rr:

θ=sr\theta = \frac{s}{r}

One radian is the angle subtended at the centre of a circle by an arc equal in length to the radius. Since the circumference of a circle is 2πr2\pi r, a full revolution is 2π2\pi radians.

Conversion Between Degrees and Radians

πrad=180\pi \mathrm{ rad} = 180^{\circ}

To convert from degrees to radians:

θrad=θdeg×π180\theta_{\mathrm{rad}} = \theta_{\mathrm{deg}} \times \frac{\pi}{180}

To convert from radians to degrees:

θdeg=θrad×180π\theta_{\mathrm{deg}} = \theta_{\mathrm{rad}} \times \frac{180}{\pi}

Arc Length

For a circle of radius rr with a central angle θ\theta (in radians):

s=rθs = r\theta

Sector Area

The area of a sector with central angle θ\theta (in radians) and radius rr:

A=12r2θA = \frac{1}{2}r^2\theta

Worked Example: Arc Length and Sector Area

Problem: A sector has radius 55 cm and central angle 3π4\frac{3\pi}{4} radians. Find the arc length and the area of the sector.

Solution:

Arc length:

s=rθ=5×3π4=15π411.78cms = r\theta = 5 \times \frac{3\pi}{4} = \frac{15\pi}{4} \approx 11.78 \mathrm{ cm}

Sector area:

A=12r2θ=12(25)(3π4)=75π829.45cm2A = \frac{1}{2}r^2\theta = \frac{1}{2}(25)\left(\frac{3\pi}{4}\right) = \frac{75\pi}{8} \approx 29.45 \mathrm{ cm}^2

Trigonometric Functions

Right-Angle Definitions

sinθ=oppositehypotenuse,cosθ=adjacenthypotenuse,tanθ=oppositeadjacent=sinθcosθ\sin \theta = \frac{\mathrm{opposite}}{\mathrm{hypotenuse}}, \quad \cos \theta = \frac{\mathrm{adjacent}}{\mathrm{hypotenuse}}, \quad \tan \theta = \frac{\mathrm{opposite}}{\mathrm{adjacent}} = \frac{\sin \theta}{\cos \theta}

Reciprocal Trigonometric Functions

cscθ=1sinθ,secθ=1cosθ,cotθ=1tanθ=cosθsinθ\csc\theta = \frac{1}{\sin\theta}, \quad \sec\theta = \frac{1}{\cos\theta}, \quad \cot\theta = \frac{1}{\tan\theta} = \frac{\cos\theta}{\sin\theta}

These are defined wherever the denominator is non-zero.

Graphs of Reciprocal Functions

FunctionDomainRangeAsymptotesxx-intercepts
y=cscxy = \csc xxnπx \neq n\piy1y \le -1 or y1y \ge 1x=nπx = n\pinone
y=secxy = \sec xxπ2+nπx \neq \frac{\pi}{2} + n\piy1y \le -1 or y1y \ge 1x=π2+nπx = \frac{\pi}{2} + n\pinone
y=cotxy = \cot xxnπx \neq n\piall real yyx=nπx = n\pix=π2+nπx = \frac{\pi}{2} + n\pi

The Unit Circle

The unit circle is a circle of radius 11 centred at the origin. Any point on the unit circle has coordinates (cosθ,sinθ)(\cos\theta, \sin\theta), where θ\theta is the angle measured anticlockwise from the positive xx-axis.

This definition extends trigonometric functions to all real numbers, not just acute angles. The Pythagorean identity follows directly from the fact that every point on the unit circle satisfies x2+y2=1x^2 + y^2 = 1.

Key Values

θ\theta00π6\frac{\pi}{6}π4\frac{\pi}{4}π3\frac{\pi}{3}π2\frac{\pi}{2}π\pi3π2\frac{3\pi}{2}2π2\pi
sinθ\sin\theta0012\frac{1}{2}22\frac{\sqrt{2}}{2}32\frac{\sqrt{3}}{2}11001-100
cosθ\cos\theta1132\frac{\sqrt{3}}{2}22\frac{\sqrt{2}}{2}12\frac{1}{2}001-10011
tanθ\tan\theta0013\frac{1}{\sqrt{3}}113\sqrt{3}undefined00undefined00

All, Sine, Tan, Cos (ASTC)

The signs of trig functions in each quadrant:

  • All positive in the first quadrant (0<θ<π20 \lt \theta \lt \frac{\pi}{2})
  • Sine positive in the second quadrant (π2<θ<π\frac{\pi}{2} \lt \theta \lt \pi)
  • Tangent positive in the third quadrant (π<θ<3π2\pi \lt \theta \lt \frac{3\pi}{2})
  • Cosine positive in the fourth quadrant (3π2<θ<2π\frac{3\pi}{2} \lt \theta \lt 2\pi)

Graphs of Trigonometric Functions

y=sinxy = \sin x

  • Domain: all real xx
  • Range: 1y1-1 \le y \le 1
  • Period: 2π2\pi
  • xx-intercepts at x=0,π,2π,x = 0, \pi, 2\pi, \ldots

y=cosxy = \cos x

  • Domain: all real xx
  • Range: 1y1-1 \le y \le 1
  • Period: 2π2\pi
  • yy-intercept at (0,1)(0, 1)

y=tanxy = \tan x

  • Domain: all real xx except x=π2+nπx = \frac{\pi}{2} + n\pi
  • Range: all real yy
  • Period: π\pi
  • Vertical asymptotes at x=π2+nπx = \frac{\pi}{2} + n\pi

Transformations

For y=asin(bx+c)+dy = a\sin(bx + c) + d:

  • a|a| = amplitude
  • 2πb\frac{2\pi}{|b|} = period
  • cc = horizontal phase shift (shift left by cb\frac{c}{b})
  • dd = vertical shift
tip

Exam Tip When sketching trig graphs, always label axis intercepts, maximum/minimum points, and show at least one full period clearly.

Trigonometric Functions: y = A sin(Bx + C) + D

Use the sliders to see how changing aa, bb, cc, and dd in y=asin(bx+c)+dy = a\sin(bx + c) + d affects the graph.

Trigonometric Identities

Pythagorean Identities

\begin`\{aligned}` \sin^2\theta + \cos^2\theta &= 1\\ 1 + \tan^2\theta &= \sec^2\theta\\ 1 + \cot^2\theta &= \csc^2\theta \end`\{aligned}`

Proof of sin2θ+cos2θ=1\sin^2\theta + \cos^2\theta = 1

By the unit circle definition, a point on the unit circle at angle θ\theta has coordinates (cosθ,sinθ)(\cos\theta, \sin\theta). Since every point on the unit circle satisfies x2+y2=1x^2 + y^2 = 1, we substitute:

cos2θ+sin2θ=1\cos^2\theta + \sin^2\theta = 1

This completes the proof.

Proof of 1+tan2θ=sec2θ1 + \tan^2\theta = \sec^2\theta

Starting from sin2θ+cos2θ=1\sin^2\theta + \cos^2\theta = 1, divide both sides by cos2θ\cos^2\theta:

sin2θcos2θ+cos2θcos2θ=1cos2θ\frac{\sin^2\theta}{\cos^2\theta} + \frac{\cos^2\theta}{\cos^2\theta} = \frac{1}{\cos^2\theta} tan2θ+1=sec2θ\tan^2\theta + 1 = \sec^2\theta

Proof of 1+cot2θ=csc2θ1 + \cot^2\theta = \csc^2\theta

Starting from sin2θ+cos2θ=1\sin^2\theta + \cos^2\theta = 1, divide both sides by sin2θ\sin^2\theta:

sin2θsin2θ+cos2θsin2θ=1sin2θ\frac{\sin^2\theta}{\sin^2\theta} + \frac{\cos^2\theta}{\sin^2\theta} = \frac{1}{\sin^2\theta} 1+cot2θ=csc2θ1 + \cot^2\theta = \csc^2\theta

Compound Angle Identities

\begin`\{aligned}` \sin(A \pm B) &= \sin A \cos B \pm \cos A \sin B\\ \cos(A \pm B) &= \cos A \cos B \mp \sin A \sin B\\ \tan(A \pm B) &= \frac{\tan A \pm \tan B}{1 \mp \tan A \tan B} \end`\{aligned}`

Proof of Compound Angle Formulas (Rotation Matrix)

Consider rotating the point (1,0)(1, 0) by angle A+BA + B anticlockwise. The resulting coordinates are (cos(A+B),sin(A+B))(\cos(A + B), \sin(A + B)).

Equivalently, we can first rotate by BB, then by AA. The rotation matrix for angle α\alpha is:

R(\alpha) = \begin`\{pmatrix}` \cos\alpha & -\sin\alpha \\ \sin\alpha & \cos\alpha \end`\{pmatrix}`

The composite rotation R(A)R(B)R(A)R(B) applied to (1,0)(1, 0):

\begin`\{pmatrix}` \cos A & -\sin A \\ \sin A & \cos A \end`\{pmatrix}` \begin`\{pmatrix}` \cos B & -\sin B \\ \sin B & \cos B \end`\{pmatrix}` \begin`\{pmatrix}` 1 \\ 0 \end`\{pmatrix}`

First multiply the matrices:

R(A)R(B) = \begin`\{pmatrix}` \cos A \cos B - \sin A \sin B & -\cos A \sin B - \sin A \cos B \\ \sin A \cos B + \cos A \sin B & -\sin A \sin B + \cos A \cos B \end`\{pmatrix}`

Applying to (1,0)(1, 0) gives the top-left and bottom-left entries:

cos(A+B)=cosAcosBsinAsinB,sin(A+B)=sinAcosB+cosAsinB\cos(A + B) = \cos A \cos B - \sin A \sin B, \quad \sin(A + B) = \sin A \cos B + \cos A \sin B

The formulas for ABA - B follow by substituting B-B and using sin(B)=sinB\sin(-B) = -\sin B, cos(B)=cosB\cos(-B) = \cos B.

Double Angle Identities

Setting A=B=θA = B = \theta in the compound angle formulas:

\begin`\{aligned}` \sin 2\theta &= 2\sin\theta \cos\theta\\[4pt] \cos 2\theta &= \cos^2\theta - \sin^2\theta\\ \tan 2\theta &= \frac{2\tan\theta}{1 - \tan^2\theta} \end`\{aligned}`

Three Forms of cos2θ\cos 2\theta

Starting from cos2θ=cos2θsin2θ\cos 2\theta = \cos^2\theta - \sin^2\theta:

  • Form 1: cos2θ=cos2θsin2θ\cos 2\theta = \cos^2\theta - \sin^2\theta
  • Form 2: Replace sin2θ=1cos2θ\sin^2\theta = 1 - \cos^2\theta: cos2θ=2cos2θ1\cos 2\theta = 2\cos^2\theta - 1
  • Form 3: Replace cos2θ=1sin2θ\cos^2\theta = 1 - \sin^2\theta: cos2θ=12sin2θ\cos 2\theta = 1 - 2\sin^2\theta

Triple Angle Identities

sin3θ=3sinθ4sin3θ\sin 3\theta = 3\sin\theta - 4\sin^3\theta

Derivation: Using sin(2θ+θ)\sin(2\theta + \theta):

sin3θ=sin2θcosθ+cos2θsinθ=2sinθcos2θ+(12sin2θ)sinθ=2sinθ(1sin2θ)+sinθ2sin3θ=3sinθ4sin3θ\sin 3\theta = \sin 2\theta \cos\theta + \cos 2\theta \sin\theta = 2\sin\theta\cos^2\theta + (1 - 2\sin^2\theta)\sin\theta = 2\sin\theta(1 - \sin^2\theta) + \sin\theta - 2\sin^3\theta = 3\sin\theta - 4\sin^3\theta

Inverse Trigonometric Functions

FunctionMeaningDomainRange
arcsinx\arcsin x"the angle whose sine is xx"1x1-1 \le x \le 1π2arcsinxπ2-\frac{\pi}{2} \le \arcsin x \le \frac{\pi}{2}
arccosx\arccos x"the angle whose cosine is xx"1x1-1 \le x \le 10arccosxπ0 \le \arccos x \le \pi
arctanx\arctan x"the angle whose tangent is xx"all real xxπ2<arctanx<π2-\frac{\pi}{2} \lt \arctan x \lt \frac{\pi}{2}

Properties

arcsin(x)=arcsin(x),arctan(x)=arctan(x),arccos(x)=πarccos(x)\arcsin(-x) = -\arcsin(x), \quad \arctan(-x) = -\arctan(x), \quad \arccos(-x) = \pi - \arccos(x)

Composition Identities

For xx in the appropriate domain:

\begin`\{aligned}` \sin(\arcsin x) &= x, \quad \mathrm{for } -1 \le x \le 1\\ \cos(\arccos x) &= x, \quad \mathrm{for } -1 \le x \le 1\\ \tan(\arctan x) &= x, \quad \mathrm{for all real } x \end`\{aligned}`

The reverse compositions are only true on restricted domains:

\begin`\{aligned}` \arcsin(\sin x) &= x, \quad \mathrm{for } -\frac{\pi}{2} \le x \le \frac{\pi}{2}\\ \arccos(\cos x) &= x, \quad \mathrm{for } 0 \le x \le \pi\\ \arctan(\tan x) &= x, \quad \mathrm{for } -\frac{\pi}{2} \lt x \lt \frac{\pi}{2} \end`\{aligned}`

Worked Example: Inverse Trig Evaluation

Problem: Evaluate sin(arccos13)\sin\left(\arccos\frac{1}{3}\right) without a calculator.

Solution:

Let θ=arccos13\theta = \arccos\frac{1}{3}, so cosθ=13\cos\theta = \frac{1}{3} with θ[0,π]\theta \in [0, \pi]. Since cosθ>0\cos\theta \gt 0, we have θ\theta in the first quadrant, so sinθ0\sin\theta \ge 0:

sinθ=119=223\sin\theta = \sqrt{1 - \frac{1}{9}} = \frac{2\sqrt{2}}{3}
tip

Exam Tip Be careful with the range of inverse trig functions. Your calculator only gives the principal value -- you may need to find other solutions using the periodic properties or the ASTC rule.

Sine and Cosine Rules

Sine Rule

asinA=bsinB=csinC\frac{a}{\sin A} = \frac{b}{\sin B} = \frac{c}{\sin C}

Used when you know:

  • Two angles and one side (AAS), or
  • Two sides and a non-included angle (SSA -- see ambiguous case below)

Cosine Rule

c2=a2+b22abcosCc^2 = a^2 + b^2 - 2ab\cos C

Or equivalently:

cosC=a2+b2c22ab\cos C = \frac{a^2 + b^2 - c^2}{2ab}

Used when you know:

  • Two sides and the included angle (SAS), or
  • All three sides (SSS)

Area of a Triangle

Area=12absinC\mathrm{Area} = \frac{1}{2}ab\sin C

Worked Example: Sine Rule

Problem: In triangle ABCABC, a=8a = 8 cm, A=45A = 45^\circ, B=30B = 30^\circ. Find bb.

Solution:

b=8sin30sin45=422=425.66cmb = \frac{8\sin 30^{\circ}}{\sin 45^{\circ}} = \frac{4}{\frac{\sqrt{2}}{2}} = 4\sqrt{2} \approx 5.66 \mathrm{ cm}

Worked Example: Cosine Rule

Problem: Find the angle CC in a triangle with sides a=5a = 5, b=7b = 7, c=8c = 8.

Solution:

cosC=52+72822×5×7=25+496470=1070=17\cos C = \frac{5^2 + 7^2 - 8^2}{2 \times 5 \times 7} = \frac{25 + 49 - 64}{70} = \frac{10}{70} = \frac{1}{7} C=arccos(17)81.8C = \arccos\left(\frac{1}{7}\right) \approx 81.8^{\circ}

Ambiguous Case of the Sine Rule

When using the sine rule with SSA (two sides and a non-included angle), there may be two possible triangles, one triangle, or no triangle.

Condition for Ambiguity

Given sides aa and bb and angle AA (where aa is opposite AA):

  • No triangle if a<bsinAa \lt b\sin A
  • One right-angled triangle if a=bsinAa = b\sin A
  • Two triangles if bsinA<a<bb\sin A \lt a \lt b and A<90A \lt 90^\circ
  • One triangle if aba \ge b or A90A \ge 90^\circ

Why Two Triangles?

When sinB=k\sin B = k where 0<k<10 \lt k \lt 1, there are two possible values for BB:

B1=arcsin(k)andB2=180arcsin(k)B_1 = \arcsin(k) \quad \mathrm{and} \quad B_2 = 180^{\circ} - \arcsin(k)

Both may be valid since B1+B2=180B_1 + B_2 = 180^\circ (so if A+B1<180A + B_1 \lt 180^\circ, check whether A+B2<180A + B_2 \lt 180^\circ as well).

Worked Example: Ambiguous Case

Problem: In triangle ABCABC, a=7a = 7, b=10b = 10, A=40A = 40^\circ. Find all possible triangles.

Solution:

Using the sine rule:

sinB10=sin407    sinB=10sin4070.919\frac{\sin B}{10} = \frac{\sin 40^{\circ}}{7} \implies \sin B = \frac{10\sin 40^{\circ}}{7} \approx 0.919

Since 0<0.919<10 \lt 0.919 \lt 1, there are two possible values for BB:

B1=arcsin(0.919)66.8,B2=18066.8=113.2B_1 = \arcsin(0.919) \approx 66.8^{\circ}, \quad B_2 = 180^{\circ} - 66.8^{\circ} = 113.2^{\circ}

Check both: A+B1=106.8<180A + B_1 = 106.8^{\circ} \lt 180^\circ and A+B2=153.2<180A + B_2 = 153.2^{\circ} \lt 180^\circ. Both are valid.

Triangle 1: B=66.8B = 66.8^\circ, C=73.2C = 73.2^\circ, c1=7sin73.2sin4010.4c_1 = \frac{7\sin 73.2^{\circ}}{\sin 40^{\circ}} \approx 10.4

Triangle 2: B=113.2B = 113.2^\circ, C=26.8C = 26.8^\circ, c2=7sin26.8sin404.89c_2 = \frac{7\sin 26.8^{\circ}}{\sin 40^{\circ}} \approx 4.89

Non-Right-Angled Triangle Problems

Strategy

  1. Draw and label a clear diagram.
  2. Identify which rule(s) to apply based on the given information.
  3. Use the sine rule for AAS or SSA, the cosine rule for SAS or SSS.
  4. For area problems, use 12absinC\frac{1}{2}ab\sin C or split into right-angled triangles.
  5. For bearing problems, remember that bearings are measured clockwise from north.

Worked Example: Multi-Step Triangle Problem

Problem: In triangle ABCABC, a=12a = 12, b=8b = 8, A=65A = 65^\circ. Find the area of the triangle.

Solution:

Find angle BB using the sine rule:

sinB8=sin6512    sinB=2sin6530.604\frac{\sin B}{8} = \frac{\sin 65^{\circ}}{12} \implies \sin B = \frac{2\sin 65^{\circ}}{3} \approx 0.604

Since b<ab \lt a, there is only one solution: B37.2B \approx 37.2^\circ, so C=77.8C = 77.8^\circ.

Area=12(12)(8)sin77.847.0squareunits\mathrm{Area} = \frac{1}{2}(12)(8)\sin 77.8^{\circ} \approx 47.0 \mathrm{ square units}

Worked Example: Bearing Problem

Problem: A ship sails from port AA on a bearing of 050050^\circ for 1515 km to point BB, then on a bearing of 110110^\circ for 2020 km to point CC. Find the distance and bearing from CC back to AA.

Solution:

The angle at BB is the change in bearing: 110050=60110^{\circ} - 050^{\circ} = 60^\circ. The interior angle at BB is 18060=120180^{\circ} - 60^{\circ} = 120^\circ.

Using the cosine rule:

AC=152+2022(15)(20)cos120=225+400+300=925=53730.4kmAC = \sqrt{15^2 + 20^2 - 2(15)(20)\cos 120^{\circ}} = \sqrt{225 + 400 + 300} = \sqrt{925} = 5\sqrt{37} \approx 30.4 \mathrm{ km}

To find the bearing, find angle CC:

sinC15=sin120537    C25.3\frac{\sin C}{15} = \frac{\sin 120^{\circ}}{5\sqrt{37}} \implies C \approx 25.3^{\circ}

The bearing from CC to AA is 36011025.3225360^{\circ} - 110^{\circ} - 25.3^{\circ} \approx 225^\circ.

Solving Trigonometric Equations

General Solutions

\begin`\{aligned}` \sin\theta &= k \implies \theta = \arcsin(k) + 2n\pi \mathrm{ or } \theta = \pi - \arcsin(k) + 2n\pi\\ \cos\theta &= k \implies \theta = \arccos(k) + 2n\pi \mathrm{ or } \theta = -\arccos(k) + 2n\pi\\ \tan\theta &= k \implies \theta = \arctan(k) + n\pi \end`\{aligned}`

where n{Z}n \in \mathbb{'\{'}Z{'\}'}.

Worked Example: Basic Trig Equation

Problem: Solve sin2x=12\sin 2x = \frac{1}{2} for x[0,2π]x \in [0, 2\pi].

Solution:

Let u=2xu = 2x, so u[0,4π]u \in [0, 4\pi].

sinu=12    u=π6,5π6,2π+π6,2π+5π6\sin u = \frac{1}{2} \implies u = \frac{\pi}{6}, \frac{5\pi}{6}, 2\pi + \frac{\pi}{6}, 2\pi + \frac{5\pi}{6} u=π6,5π6,13π6,17π6u = \frac{\pi}{6}, \frac{5\pi}{6}, \frac{13\pi}{6}, \frac{17\pi}{6} x=u2=π12,5π12,13π12,17π12x = \frac{u}{2} = \frac{\pi}{12}, \frac{5\pi}{12}, \frac{13\pi}{12}, \frac{17\pi}{12}

Worked Example: Factoring

Problem: Solve 2cos2xcosx1=02\cos^2 x - \cos x - 1 = 0 for x[0,2π]x \in [0, 2\pi].

Solution:

Let u=cosxu = \cos x:

2u2u1=0    (2u+1)(u1)=02u^2 - u - 1 = 0 \implies (2u + 1)(u - 1) = 0 u=12oru=1u = -\frac{1}{2} \mathrm{ or } u = 1
  • cosx=12    x=2π3,4π3\cos x = -\frac{1}{2} \implies x = \frac{2\pi}{3}, \frac{4\pi}{3}
  • cosx=1    x=0\cos x = 1 \implies x = 0

So x=0,2π3,4π3x = 0, \frac{2\pi}{3}, \frac{4\pi}{3}.

Worked Example: Using Identities

Problem: Solve sin2x=3cos2x\sin^2 x = 3\cos^2 x for x[0,2π]x \in [0, 2\pi].

Solution:

Replace cos2x\cos^2 x with 1sin2x1 - \sin^2 x:

sin2x=3(1sin2x)    sin2x=33sin2x    4sin2x=3\sin^2 x = 3(1 - \sin^2 x) \implies \sin^2 x = 3 - 3\sin^2 x \implies 4\sin^2 x = 3 sin2x=34    sinx=±32\sin^2 x = \frac{3}{4} \implies \sin x = \pm\frac{\sqrt{3}}{2}

Since sinx>0\sin x \gt 0 in quadrants I and II, and sinx<0\sin x \lt 0 in quadrants III and IV:

x=π3,2π3,4π3,5π3x = \frac{\pi}{3}, \frac{2\pi}{3}, \frac{4\pi}{3}, \frac{5\pi}{3}

Worked Example: Equations Involving tan\tan

Problem: Solve tan2x=1\tan 2x = 1 for x[0,π]x \in [0, \pi].

Solution:

Since tan\tan has period π\pi, tan2x=1\tan 2x = 1 gives 2x=π4+nπ2x = \frac{\pi}{4} + n\pi for n{Z}n \in \mathbb{'\{'}Z{'\}'}.

x=π8+nπ2x = \frac{\pi}{8} + \frac{n\pi}{2}

For x[0,π]x \in [0, \pi]:

  • n=0n = 0: x=π8x = \frac{\pi}{8}
  • n=1n = 1: x=π8+π2=5π8x = \frac{\pi}{8} + \frac{\pi}{2} = \frac{5\pi}{8}
  • n=2n = 2: x=π8+π=9π8>πx = \frac{\pi}{8} + \pi = \frac{9\pi}{8} \gt \pi (outside range)

So x=π8,5π8x = \frac{\pi}{8}, \frac{5\pi}{8}.

Harmonic Form: Rsin(x±α)R\sin(x \pm \alpha) and Rcos(x±α)R\cos(x \pm \alpha)

Expressions of the form asinx+bcosxa\sin x + b\cos x can be written as a single trigonometric function:

asinx+bcosx=Rsin(x+α)a\sin x + b\cos x = R\sin(x + \alpha)

where R=a2+b2R = \sqrt{a^2 + b^2} and tanα=ba\tan\alpha = \frac{b}{a}.

This is useful for finding maximum/minimum values and for solving equations.

Worked Example: Harmonic Form

Problem: Express 3sinx+4cosx3\sin x + 4\cos x in the form Rsin(x+α)R\sin(x + \alpha), and hence solve 3sinx+4cosx=53\sin x + 4\cos x = 5 for x[0,2π]x \in [0, 2\pi].

Solution:

R=32+42=5R = \sqrt{3^2 + 4^2} = 5 tanα=43    α=arctan430.927rad\tan\alpha = \frac{4}{3} \implies \alpha = \arctan\frac{4}{3} \approx 0.927 \mathrm{ rad}

So 3sinx+4cosx=5sin(x+0.927)3\sin x + 4\cos x = 5\sin(x + 0.927).

Solving 5sin(x+0.927)=55\sin(x + 0.927) = 5:

sin(x+0.927)=1    x+0.927=π2+2nπ\sin(x + 0.927) = 1 \implies x + 0.927 = \frac{\pi}{2} + 2n\pi x=π20.927+2nπ0.644+2nπx = \frac{\pi}{2} - 0.927 + 2n\pi \approx 0.644 + 2n\pi

For x[0,2π]x \in [0, 2\pi]: x0.644x \approx 0.644 rad (the next value 0.644+2π0.644 + 2\pi exceeds 2π2\pi).

3D Trigonometry

3D trigonometry involves applying trigonometric ratios in three-dimensional problems. The key is to identify right-angled triangles within the 3D shape.

Strategy

  1. Draw a clear diagram of the 3D shape.
  2. Identify the relevant 2D triangles (often by drawing auxiliary lines).
  3. Label known sides and angles.
  4. Apply Pythagoras' theorem, sine rule, cosine rule, or basic trig ratios.

Worked Example: 3D Problem

Problem: A pyramid has a square base of side 66 cm and vertical height 44 cm. Find the angle between a sloping edge and the base.

Solution:

The distance from the centre of the base to a vertex is 622=32\frac{6\sqrt{2}}{2} = 3\sqrt{2} cm.

θ=arctan(432)=arctan(223)43.3\theta = \arctan\left(\frac{4}{3\sqrt{2}}\right) = \arctan\left(\frac{2\sqrt{2}}{3}\right) \approx 43.3^{\circ}

Trigonometric Proof Strategies

General Approach

In IB exams, trigonometric proofs typically ask you to show that one expression equals another. The standard approach is:

  1. Start with one side -- usually the more complex side (LHS).
  2. Apply known identities to transform it step by step toward the other side.
  3. Never assume what you are trying to prove -- work forward from a known truth.

Useful Techniques

  • Factor: Look for common factors, e.g., sinx+sinxcosx=sinx(1+cosx)\sin x + \sin x\cos x = \sin x(1 + \cos x).
  • Use sin2+cos2=1\sin^2 + \cos^2 = 1: Convert everything to sines or everything to cosines.
  • Convert to sin\sin and cos\cos: When tan\tan, sec\sec, csc\csc, or cot\cot appear, express them in terms of sin\sin and cos\cos.
  • Look for compound angle structure: Recognise when an expression matches sin(A±B)\sin(A \pm B) or cos(A±B)\cos(A \pm B).
  • Common denominator: When fractions appear, combine them over a single denominator.

Worked Example: Proof by Multiplication

Problem: Prove that sinx1+cosx=1cosxsinx\frac{\sin x}{1 + \cos x} = \frac{1 - \cos x}{\sin x}.

Proof:

Multiply numerator and denominator by 1cosx1 - \cos x:

sinx(1cosx)(1+cosx)(1cosx)=sinx(1cosx)1cos2x=sinx(1cosx)sin2x=1cosxsinx=RHS\frac{\sin x(1 - \cos x)}{(1 + \cos x)(1 - \cos x)} = \frac{\sin x(1 - \cos x)}{1 - \cos^2 x} = \frac{\sin x(1 - \cos x)}{\sin^2 x} = \frac{1 - \cos x}{\sin x} = \mathrm{RHS}

Worked Example: Proof Using Identities

Problem: Prove that 1cos2xsin2x=tanx\frac{1 - \cos 2x}{\sin 2x} = \tan x.

Proof:

Using cos2x=12sin2x\cos 2x = 1 - 2\sin^2 x and sin2x=2sinxcosx\sin 2x = 2\sin x\cos x:

1(12sin2x)2sinxcosx=2sin2x2sinxcosx=sinxcosx=tanx=RHS\frac{1 - (1 - 2\sin^2 x)}{2\sin x\cos x} = \frac{2\sin^2 x}{2\sin x\cos x} = \frac{\sin x}{\cos x} = \tan x = \mathrm{RHS}

Worked Example: Proof with Compound Angles

Problem: Prove that sin(A+B)cosAcosB=tanA+tanB\frac{\sin(A + B)}{\cos A \cos B} = \tan A + \tan B.

Proof:

Expand sin(A+B)\sin(A + B) and split the fraction:

sinAcosB+cosAsinBcosAcosB=sinAcosA+sinBcosB=tanA+tanB=RHS\frac{\sin A \cos B + \cos A \sin B}{\cos A \cos B} = \frac{\sin A}{\cos A} + \frac{\sin B}{\cos B} = \tan A + \tan B = \mathrm{RHS}

Common Pitfalls

Forgetting to Check All Solutions

When solving sinθ=k\sin\theta = k or cosθ=k\cos\theta = k, there are always (at least) two solutions per period. A common mistake is to find arcsin(k)\arcsin(k) but forget πarcsin(k)\pi - \arcsin(k).

Mixing Up Degrees and Radians

Ensure your calculator is in the correct mode. If an angle is given as π3\frac{\pi}{3}, it is in radians; if given as 6060^\circ, it is in degrees. Forgetting to convert is one of the most frequent errors.

Wrong Sign in Compound Angle Formulas

For cos(AB)\cos(A - B):

cos(AB)=cosAcosB+sinAsinB\cos(A - B) = \cos A \cos B + \sin A \sin B

The sinAsinB\sin A \sin B term is positive (the \mp from the ±\pm formula flips). Students often incorrectly write a minus sign here.

Ambiguous Case of the Sine Rule

When using the sine rule with SSA data, always check whether two triangles are possible. If sinB=k\sin B = k with 0<k<10 \lt k \lt 1 and BB is acute, then 180B180^{\circ} - B may also be valid.

Domain of Inverse Functions

arcsinx\arcsin x and arctanx\arctan x return values in [π2,π2][-\frac{\pi}{2}, \frac{\pi}{2}], while arccosx\arccos x returns values in [0,π][0, \pi]. If the actual angle is in a different quadrant, you must adjust using ASTC.

Problem Set

Problem 1: Radian Measure

Problem: A circle has radius r=8r = 8 cm. A sector of the circle has area 4848 cm2^2. Find the exact arc length of the sector.

Solution:

Using the sector area formula A=12r2θA = \frac{1}{2}r^2\theta:

48=12(64)θ    48=32θ    θ=32rad48 = \frac{1}{2}(64)\theta \implies 48 = 32\theta \implies \theta = \frac{3}{2} \mathrm{ rad}

Arc length s=rθ=8×32=12s = r\theta = 8 \times \frac{3}{2} = 12 cm.

Problem 2: Compound Angle Identity

Problem: Given that sinα=35\sin\alpha = \frac{3}{5} and cosβ=1213\cos\beta = \frac{12}{13}, where α\alpha and β\beta are acute angles, find the exact value of sin(α+β)\sin(\alpha + \beta).

Solution:

Since α\alpha is acute: cosα=1925=45\cos\alpha = \sqrt{1 - \frac{9}{25}} = \frac{4}{5}. Since β\beta is acute: sinβ=1144169=513\sin\beta = \sqrt{1 - \frac{144}{169}} = \frac{5}{13}.

sin(α+β)=sinαcosβ+cosαsinβ=351213+45513=3665+2065=5665\sin(\alpha + \beta) = \sin\alpha\cos\beta + \cos\alpha\sin\beta = \frac{3}{5} \cdot \frac{12}{13} + \frac{4}{5} \cdot \frac{5}{13} = \frac{36}{65} + \frac{20}{65} = \frac{56}{65}
Problem 3: Trigonometric Equation (Factoring)

Problem: Solve 2sin2xsinx1=02\sin^2 x - \sin x - 1 = 0 for x[0,2π]x \in [0, 2\pi].

Solution:

Let u=sinxu = \sin x: 2u2u1=0    (2u+1)(u1)=0    u=122u^2 - u - 1 = 0 \implies (2u + 1)(u - 1) = 0 \implies u = -\frac{1}{2} or u=1u = 1.

  • sinx=12    x=7π6,11π6\sin x = -\frac{1}{2} \implies x = \frac{7\pi}{6}, \frac{11\pi}{6} (quadrants III and IV)
  • sinx=1    x=π2\sin x = 1 \implies x = \frac{\pi}{2}

So x=π2,7π6,11π6x = \frac{\pi}{2}, \frac{7\pi}{6}, \frac{11\pi}{6}.

Problem 4: Double Angle Application

Problem: Solve cos2x=cosx\cos 2x = \cos x for x[0,2π]x \in [0, 2\pi].

Solution:

Using cos2x=2cos2x1\cos 2x = 2\cos^2 x - 1: 2cos2x1=cosx    2cos2xcosx1=02\cos^2 x - 1 = \cos x \implies 2\cos^2 x - \cos x - 1 = 0.

Let u=cosxu = \cos x: (2u+1)(u1)=0    u=12(2u + 1)(u - 1) = 0 \implies u = -\frac{1}{2} or u=1u = 1.

  • cosx=12    x=2π3,4π3\cos x = -\frac{1}{2} \implies x = \frac{2\pi}{3}, \frac{4\pi}{3}
  • cosx=1    x=0,2π\cos x = 1 \implies x = 0, 2\pi

So x=0,2π3,4π3,2πx = 0, \frac{2\pi}{3}, \frac{4\pi}{3}, 2\pi.

Problem 5: Non-Right-Angled Triangle

Problem: In triangle PQRPQR, p=13p = 13, q=14q = 14, r=15r = 15. Find the largest angle of the triangle.

Solution:

The largest angle is opposite the longest side, so it is angle RR (opposite r=15r = 15).

Using the cosine rule:

cosR=132+1421522×13×14=169+196225364=140364=513\cos R = \frac{13^2 + 14^2 - 15^2}{2 \times 13 \times 14} = \frac{169 + 196 - 225}{364} = \frac{140}{364} = \frac{5}{13}R=arccos51367.4R = \arccos\frac{5}{13} \approx 67.4^{\circ}
Problem 6: Trigonometric Proof

Problem: Prove that tan2xsin2x=tan2xsin2x\tan^2 x - \sin^2 x = \tan^2 x \sin^2 x.

Proof:

Starting from the LHS:

tan2xsin2x=sin2xcos2xsin2x=sin2x(1cos2x1)=sin2x1cos2xcos2x=sin2xsin2xcos2x=tan2xsin2x=RHS\tan^2 x - \sin^2 x = \frac{\sin^2 x}{\cos^2 x} - \sin^2 x = \sin^2 x\left(\frac{1}{\cos^2 x} - 1\right) = \sin^2 x \cdot \frac{1 - \cos^2 x}{\cos^2 x} = \sin^2 x \cdot \frac{\sin^2 x}{\cos^2 x} = \tan^2 x \sin^2 x = \mathrm{RHS}
Problem 7: Harmonic Form

Problem: Express sinx+3cosx\sin x + \sqrt{3}\cos x in the form Rsin(x+α)R\sin(x + \alpha) and state the maximum value.

Solution:

R=12+(3)2=1+3=2R = \sqrt{1^2 + (\sqrt{3})^2} = \sqrt{1 + 3} = 2tanα=31=3    α=π3\tan\alpha = \frac{\sqrt{3}}{1} = \sqrt{3} \implies \alpha = \frac{\pi}{3}

So sinx+3cosx=2sin(x+π3)\sin x + \sqrt{3}\cos x = 2\sin\left(x + \frac{\pi}{3}\right).

The maximum value is R=2R = 2, occurring when x+π3=π2+2nπx + \frac{\pi}{3} = \frac{\pi}{2} + 2n\pi, i.e., x=π6+2nπx = \frac{\pi}{6} + 2n\pi.

Problem 8: 3D Trigonometry

Problem: A cuboid has dimensions 5×4×35 \times 4 \times 3 cm. Find the angle that the diagonal of the cuboid makes with the base.

Solution:

The space diagonal has length 52+42+32=50=52\sqrt{5^2 + 4^2 + 3^2} = \sqrt{50} = 5\sqrt{2} cm.

The projection of this diagonal onto the base has length 52+42=41\sqrt{5^2 + 4^2} = \sqrt{41} cm.

The angle θ\theta between the space diagonal and its projection onto the base is the angle with the base:

sinθ=352=3210\sin\theta = \frac{3}{5\sqrt{2}} = \frac{3\sqrt{2}}{10}θ=arcsin321025.1\theta = \arcsin\frac{3\sqrt{2}}{10} \approx 25.1^{\circ}

Alternatively, using the tangent:

tanθ=341    θ=arctan34125.1\tan\theta = \frac{3}{\sqrt{41}} \implies \theta = \arctan\frac{3}{\sqrt{41}} \approx 25.1^{\circ}


tip

Diagnostic Test Ready to test your understanding of Trigonometry? The diagnostic test contains the hardest questions within the IB specification for this topic, each with a full worked solution.

Unit tests probe edge cases and common misconceptions. Integration tests combine Trigonometry with other IB mathematics topics to test synthesis under exam conditions.

See Diagnostic Guide for instructions on self-marking and building a personal test matrix.