Skip to main content

Organic Chemistry (Advanced)

1. Reaction Mechanisms

SN1 Mechanism (Unimolecular Nucleophilic Substitution)

Definition. SN1 proceeds via a two-step mechanism where the rate depends only on the concentration of the substrate.

Step 1 (slow, rate-determining): Heterolytic cleavage of the C--X bond to form a carbocation intermediate.

(CH3)3CBr(CH3)3C++Br\mathrm{(CH_3)_3C\mathrm{-}Br} \to \mathrm{(CH_3)_3C^+} + \mathrm{Br}^-

Step 2 (fast): Nucleophilic attack on the planar carbocation.

(CH3)3C++OH(CH3)3COH\mathrm{(CH_3)_3C^+} + \mathrm{OH}^- \to \mathrm{(CH_3)_3COH}

Rate law: rate=k[substrate]\mathrm{rate} = k[\mathrm{substrate}] (first order)

Characteristics:

FeatureSN1
KineticsFirst order
MechanismTwo steps, carbocation intermediate
StereochemistryRacemisation (attack from both sides)
Substrate preferenceTertiary >\gt secondary (primary never)
Nucleophile strengthWeak nucleophiles are sufficient
Leaving groupNeeds a good leaving group
RearrangementsPossible (hydride or alkyl shifts)

SN2 Mechanism (Bimolecular Nucleophilic Substitution)

Definition. SN2 proceeds via a single concerted step where the nucleophile attacks from the back side as the leaving group departs.

OH+CH3BrTSCH3OH+Br\mathrm{OH}^- + \mathrm{CH_3\mathrm{-}Br} \to \mathrm{TS} \to \mathrm{CH_3OH} + \mathrm{Br}^-

Rate law: rate=k[substrate][nucleophile]\mathrm{rate} = k[\mathrm{substrate}][\mathrm{nucleophile}] (second order)

Characteristics:

FeatureSN2
KineticsSecond order
MechanismOne concerted step, transition state
StereochemistryWalden inversion (back-side attack)
Substrate preferencePrimary >\gt secondary (tertiary never)
Nucleophile strengthStrong nucleophiles required
Leaving groupNeeds a good leaving group
RearrangementsNot possible

E1 Mechanism (Unimolecular Elimination)

Two-step mechanism via a carbocation intermediate (same intermediate as SN1):

Step 1: Formation of carbocation (rate-determining).

Step 2: Base removes a proton from an adjacent carbon, forming a double bond.

rate=k[substrate]\mathrm{rate} = k[\mathrm{substrate}]

E2 Mechanism (Bimolecular Elimination)

Concerted mechanism: the base removes a proton while the leaving group departs, forming a double bond in a single step.

rate=k[substrate][base]\mathrm{rate} = k[\mathrm{substrate}][\mathrm{base}]

Comparing SN1, SN2, E1, E2

FactorFavours SN1/E1Favours SN2/E2
SubstrateTertiaryPrimary, methyl
Nucleophile/BaseWeakStrong
Leaving groupGood (I^-, Br^-)Good (I^-, Br^-)
TemperatureLower (substitution)Higher (elimination)
SolventPolar protic (stabilises carbocation)Polar aprotic (does not stabilise carbocation)
Base concentrationLowHigh

Zaitsev's Rule

When multiple alkenes can form, the more substituted (more stable) alkene is the major product:

CH3CH2CH(CH3)CH2BrE2CH3CH2C(CH3)=CH2(minor,Hofmann)\mathrm{CH_3CH_2CH(CH_3)CH_2Br} \xrightarrow{\mathrm{E2}} \mathrm{CH_3CH_2C(CH_3)=CH_2} \mathrm{ (minor, Hofmann)} CH3CH2CH(CH3)CH2BrE2CH3CH=C(CH3)CH3(major,Zaitsev)\mathrm{CH_3CH_2CH(CH_3)CH_2Br} \xrightarrow{\mathrm{E2}} \mathrm{CH_3CH=C(CH_3)CH_3} \mathrm{ (major, Zaitsev)}

Common Pitfalls

  • Primary substrates do not undergo SN1 or E1 (they cannot form stable carbocations).
  • Tertiary substrates do not undergo SN2 (steric hindrance blocks back-side attack).
  • Strong bases favour E2 over SN2, especially at elevated temperatures.

2. Stereochemistry

Chirality

Definition. A molecule is chiral if it is not superimposable on its mirror image. A chiral centre (stereocentre) is a carbon atom bonded to four different groups.

Enantiomers

Definition. Enantiomers are non-superimposable mirror images. They have identical physical properties (melting point, solubility) except for their interaction with plane-polarised light and with other chiral molecules.

Optical Activity

  • Dextrorotatory (++ or dd): rotates plane-polarised light clockwise.
  • Laevorotatory (- or ll): rotates plane-polarised light anticlockwise.
  • A racemic mixture (50:5050:50 mixture of enantiomers) shows no optical rotation.

Cahn-Ingold-Prelog (CIP) Priority Rules

Assign priorities to the four groups on a stereocentre:

  1. Higher atomic number = higher priority.
  2. If tied, look at the next atoms outward.
  3. Double bonds are treated as if each atom is duplicated.
  4. Orient the molecule so the lowest priority group points away.
  5. If the remaining three groups go clockwise: RR (rectus). Anticlockwise: SS (sinister).

Diastereomers

Definition. Diastereomers are stereoisomers that are not mirror images. They have different physical properties.

Geometric (cis/trans) Isomerism

Restricted rotation around a C=C double bond or a ring gives rise to geometric isomers.

For C=C: assign priorities using CIP rules. If the two higher-priority groups are on the same side: ZZ (zusammen). Opposite sides: EE (entgegen).

IsomerDescriptionExample
ciscisSame side (similar groups)ciscis-but-2-ene
transtransOpposite sidestranstrans-but-2-ene
ZZHigher priority groups same side(Z)(Z)-1-bromo-1-chloropropene
EEHigher priority groups opposite(E)(E)-1-bromo-1-chloropropene

Optical vs Geometric Isomerism

PropertyOptical IsomerismGeometric Isomerism
CauseChiral centreRestricted rotation (C=C, ring)
Mirror imagesNon-superimposableNot necessarily mirror images
Physical propertiesIdentical (except optical)Different

Common Pitfalls

  • A molecule with a plane of symmetry is never chiral, even if it has stereocentres (meso compounds).
  • Not all stereocentres produce chirality — internal symmetry can make a molecule achiral.
  • RR/SS refers to absolute configuration at a single stereocentre; it does not predict the direction of optical rotation.

3. Addition Polymers

Mechanism

Addition polymers form from alkene monomers via free-radical addition. The double bond opens and monomers link together in a chain.

Initiation: A peroxide or other radical initiator generates free radicals.

ROOR2RO\mathrm{ROOR} \to 2\mathrm{RO}^{\bullet}

Propagation: The radical adds to a monomer, and the new radical adds to another monomer.

RO+CH2=CHRROCH2CHRROCH2CHRCH2CHR\mathrm{RO}^{\bullet} + \mathrm{CH_2=CHR} \to \mathrm{ROCH_2CHR}^{\bullet} \to \mathrm{ROCH_2CHRCH_2CHR}^{\bullet} \to \cdots

Termination: Two radicals combine, ending chain growth.

Common Addition Polymers

MonomerPolymerUses
EthenePolyethene (PE)Bags, bottles, film
PropenePolypropene (PP)Containers, ropes, carpet fibre
Chloroethene (vinyl chloride)PVCPipes, window frames, insulation
Phenylethene (styrene)Polystyrene (PS)Packaging, insulation, CD cases
TetrafluoroethenePTFE (Teflon)Non-stick coatings, electrical insulation

Biodegradability

Most addition polymers are non-biodegradable because the strong C--C backbone resists chemical and biological breakdown. Disposal by landfill or incineration creates environmental problems.

Common Pitfalls

  • The repeating unit of an addition polymer is not the same as the monomer (the double bond is gone).
  • Condensation polymers and addition polymers are formed by different mechanisms — do not confuse them.

4. Condensation Polymers

Mechanism

Condensation polymers form when monomers join with the elimination of a small molecule (usually H2O\mathrm{H}_2\mathrm{O} or HCl\mathrm{HCl}). Two types:

Polyesters

Formed from a diol and a dicarboxylic acid:

diol+dicarboxylicacidpolyester+H2O\mathrm{diol} + \mathrm{dicarboxylic acid} \to \mathrm{polyester} + \mathrm{H}_2\mathrm{O}
Example — PET (polyethylene terephthalate)

Monomers: ethane-1,2-diol and benzene-1,4-dicarboxylic acid.

nHOCH2CH2OH+nHOOCC6H4COOHPET+2nH2On\mathrm{HOCH_2CH_2OH} + n\mathrm{HOOC\mathrm{-}C_6H_4\mathrm{-}COOH} \to \mathrm{PET} + 2n\mathrm{H}_2\mathrm{O}

Uses: fibres (clothing), bottles, food containers.

Polyamides (Nylons)

Formed from a diamine and a dicarboxylic acid:

diamine+dicarboxylicacidpolyamide+H2O\mathrm{diamine} + \mathrm{dicarboxylic acid} \to \mathrm{polyamide} + \mathrm{H}_2\mathrm{O}
Example — Nylon-6,6

Monomers: hexane-1,6-diamine and hexanedioic acid.

nH2N(CH2)6NH2+nHOOC(CH2)4COOHNylon6,6+2nH2On\mathrm{H_2N(CH_2)_6NH_2} + n\mathrm{HOOC(CH_2)_4COOH} \to \mathrm{Nylon-6,6} + 2n\mathrm{H}_2\mathrm{O}

Uses: textiles, ropes, parachutes, engineering plastics.

Kevlar

An aromatic polyamide (aramid) with exceptional strength:

benzene1,4diamine+benzene1,4dicarboxylicacidKevlar\mathrm{benzene-1,4-diamine} + \mathrm{benzene-1,4-dicarboxylic acid} \to \mathrm{Kevlar}

The rigid aromatic rings and strong hydrogen bonding between chains give Kevlar its high tensile strength. Used in body armour, tyres, and aerospace.

Comparison of Polymer Types

PropertyAddition polymerCondensation polymer
MonomersAlkenesDiols + diacids / diamines + diacids
By-productNoneH2O\mathrm{H}_2\mathrm{O} or HCl\mathrm{HCl}
BiodegradabilityGenerally non-biodegradableSome are biodegradable
Bond typeC--C backboneContains ester or amide bonds
ExamplesPE, PP, PVC, PTFEPET, Nylon, Kevlar

5. Spectroscopic Identification of Organic Compounds

Combined Strategy

  1. Calculate the degree of unsaturation (double bond equivalents, DBE):
DBE=C+1H2+N2\mathrm{DBE} = C + 1 - \frac{H}{2} + \frac{N}{2}

(For each halogen, add 1 to H. For each oxygen, ignore.)

  1. IR spectroscopy: identify functional groups from characteristic absorptions.

  2. 1H\mathrm{^1H} NMR: determine proton environments, integration, and splitting.

  3. Mass spectrometry: determine molecular mass and fragmentation pattern.

  4. Assemble all fragments into a consistent structure.

Degree of Unsaturation Examples

Molecular formulaDBEPossible features
C4H10\mathrm{C}_4\mathrm{H}_{10}00No double bonds, no rings (alkane)
C4H8\mathrm{C}_4\mathrm{H}_811One double bond or one ring
C4H6\mathrm{C}_4\mathrm{H}_622Two double bonds, one triple, or two rings
C6H6\mathrm{C}_6\mathrm{H}_644Benzene ring (three double bonds + ring)

Characteristic IR Absorptions (Recap)

BondRange (cm1\mathrm{cm}^{-1})
O--H (acid)25002500--33003300 (very broad)
O--H (alcohol)32003200--36003600 (broad)
N--H33003300--35003500
C--H (alkane)28502850--30003000
C--H (alkene)30003000--31003100
C\equivN22002200--22502250
C=O17001700--17501750
C=C16001600--16801680

Key NMR Chemical Shifts (Recap)

Proton typeδ\delta (ppm)
Alkane0.70.7--1.51.5
Adjacent to C=O2.02.0--2.72.7
Alkene4.54.5--6.56.5
Aromatic6.56.5--8.08.0
Aldehyde9.09.0--10.010.0
Carboxylic acid10.010.0--12.012.0

Common Pitfalls

  • DBE = 4 is a strong indicator of a benzene ring, but not proof by itself.
  • In 1H\mathrm{^1H} NMR, the integration ratio must be multiplied by the total number of protons (determined from the molecular formula).
  • D2O\mathrm{D}_2\mathrm{O} exchange removes OH and NH signals, confirming their presence.

Practice Problems

Problem 1

For each substrate, predict whether SN1, SN2, E1, or E2 will be the major pathway:

(a) CH3CH2Br\mathrm{CH_3CH_2Br} with NaOH\mathrm{NaOH} in H2O\mathrm{H}_2\mathrm{O} at 25°C25\degree\mathrm{C}

(b) (CH3)3CBr(\mathrm{CH_3})_3\mathrm{CBr} with NaOH\mathrm{NaOH} in ethanol at 80°C80\degree\mathrm{C}

(c) (CH3)3CBr(\mathrm{CH_3})_3\mathrm{CBr} with H2O\mathrm{H}_2\mathrm{O} at 25°C25\degree\mathrm{C}

Solution:

(a) SN2: primary substrate, strong nucleophile/base, polar protic solvent, low temperature.

(b) E2: tertiary substrate, strong base, high temperature favours elimination over substitution.

(c) SN1: tertiary substrate, weak nucleophile (water), polar protic solvent, low temperature. The carbocation intermediate is stable.

Problem 2

An unknown compound has molecular formula C3H6O2\mathrm{C}_3\mathrm{H}_6\mathrm{O}_2. Its IR spectrum shows a broad peak at 3000cm13000\mathrm{ cm}^{-1} and a strong peak at 1710cm11710\mathrm{ cm}^{-1}. Its 1H\mathrm{^1H} NMR spectrum shows: δ 1.2 (d, 3H)\delta\ 1.2\ (d,\ 3\mathrm{H}), δ 4.1 (q, 1H)\delta\ 4.1\ (q,\ 1\mathrm{H}), δ 11.0 (s, 1H)\delta\ 11.0\ (s,\ 1\mathrm{H}), and a singlet at δ 2.0\delta\ 2.0 that integrates to 1H1\mathrm{H}.

Wait — the formula only has 6 H. Let me correct: δ 1.2 (d, 3H)\delta\ 1.2\ (d,\ 3\mathrm{H}), δ 2.5 (q, 2H)\delta\ 2.5\ (q,\ 2\mathrm{H}), δ 11.5 (s, 1H)\delta\ 11.5\ (s,\ 1\mathrm{H}). Identify the compound.

Solution:

  • C3H6O2\mathrm{C}_3\mathrm{H}_6\mathrm{O}_2: DBE=3+16/2=1\mathrm{DBE} = 3 + 1 - 6/2 = 1 (one C=O).
  • IR: broad 3000cm13000\mathrm{ cm}^{-1} (O--H) + 1710cm11710\mathrm{ cm}^{-1} (C=O) = carboxylic acid.
  • NMR: d,3Hd, 3\mathrm{H} + q,2Hq, 2\mathrm{H} = ethyl group (CH3CH2\mathrm{CH_3CH_2}--). s,1Hs, 1\mathrm{H} = COOH proton.
  • Structure: CH3CH2COOH\mathrm{CH_3CH_2COOH} (propanoic acid).

Check: M = 3(12)+6(1)+2(16)=743(12) + 6(1) + 2(16) = 74. But C3H6O2\mathrm{C}_3\mathrm{H}_6\mathrm{O}_2 has M = 74. Confirmed.

Problem 3

Draw the repeating unit of the polyester formed from propane-1,3-diol and butanedioic acid. Write the equation for its formation.

Solution:

nHOCH2CH2CH2OH+nHOOCCH2CH2COOH[OCH2CH2CH2OOCCH2CH2CO]n+2nH2On\mathrm{HOCH_2CH_2CH_2OH} + n\mathrm{HOOCCH_2CH_2COOH} \to \left[-\mathrm{OCH_2CH_2CH_2OOCCH_2CH_2CO}-\right]_n + 2n\mathrm{H}_2\mathrm{O}

Repeating unit: OCH2CH2CH2OOCCH2CH2CO-\mathrm{OCH_2CH_2CH_2OOCCH_2CH_2CO}-

Problem 4

A compound C5H10O\mathrm{C}_5\mathrm{H}_{10}\mathrm{O} shows the following spectra. IR: strong peak at 1700cm11700\mathrm{ cm}^{-1}, no broad O--H. 1H\mathrm{^1H} NMR: δ 1.0 (t, 3H)\delta\ 1.0\ (t,\ 3\mathrm{H}), δ 1.6 (m, 2H)\delta\ 1.6\ (m,\ 2\mathrm{H}), δ 2.1 (s, 3H)\delta\ 2.1\ (s,\ 3\mathrm{H}), δ 2.3 (t, 2H)\delta\ 2.3\ (t,\ 2\mathrm{H}). Identify the compound.

Solution:

  • C5H10O\mathrm{C}_5\mathrm{H}_{10}\mathrm{O}: DBE=5+110/2=1\mathrm{DBE} = 5 + 1 - 10/2 = 1 (one C=O).
  • IR: 1700cm11700\mathrm{ cm}^{-1} (C=O), no O--H = ketone or aldehyde. No aldehyde peak around δ 9\delta\ 9--1010, so it is a ketone.
  • NMR: triplet + multiplet + triplet = propyl chain (CH3CH2CH2\mathrm{CH_3CH_2CH_2}--). Singlet at δ 2.1\delta\ 2.1 (3H3\mathrm{H}) = CH3CO\mathrm{CH_3CO}--.
  • Structure: \mathrm{CH_3COCH_2CH_2CH_3 (pentan-2-one).

Total protons: 3+2+3+2=10=C5H10O3 + 2 + 3 + 2 = 10 = \mathrm{C}_5\mathrm{H}_{10}\mathrm{O}. Confirmed.


Worked Examples

Worked Example: Predicting the major organic product of a substitution reaction

Predict the major product when (CH3)3CBr(CH_3)_3CBr is heated with KOH\mathrm{KOH} in ethanol. State the mechanism, draw the transition state or intermediate, and explain the regiochemistry.

Solution

Substrate analysis: (CH3)3CBr(CH_3)_3CBr is a tertiary alkyl halide.

Conditions: KOH\mathrm{KOH} (strong base) in ethanol (polar protic solvent) at elevated temperature.

Mechanism determination: Tertiary substrate + strong base + heat \to E2 is favoured over SN2. SN1 is also possible but elevated temperature shifts the product distribution toward elimination.

Major product: E2 elimination.

The base abstracts a proton from a β\beta-carbon while the leaving group departs. By Zaitsev's rule, the more substituted (more stable) alkene is the major product:

(CH3)3CBr+KOH(CH3)2C=CH2+KBr+H2O\mathrm{(CH_3)_3CBr + KOH \to (CH_3)_2C=CH_2 + KBr + H_2O}

This is the Hofmann product (less substituted). The Zaitsev product would require removing a proton from a methyl group:

(CH3)3CBr+KOHCH3CH=C(CH3)2+KBr+H2O\mathrm{(CH_3)_3CBr + KOH \to CH_3CH=C(CH_3)_2 + KBr + H_2O}

Actually, for (CH3)3CBr(CH_3)_3CBr, there are no β\beta-hydrogens on the carbon bearing two methyl groups that are distinct from the terminal methyl groups. The only elimination products are (CH3)2C=CH2(CH_3)_2C=CH_2 (the only possible alkene). Since there is only one type of β\beta-hydrogen, Zaitsev's rule does not apply here --- there is only one elimination product.

SN1 product (minor): (CH3)3COH(CH_3)_3COH (tert-butanol), formed via a carbocation intermediate with water as the nucleophile.

Worked Example: CIP priority rules and R/S assignment

Assign the absolute configuration (R or S) to the stereocentre in CH3CHClCH2CH3\mathrm{CH_3CHClCH_2CH_3} (2-chlorobutane).

Solution

Step 1: Identify the stereocentre.

Carbon-2 is bonded to four different groups: H-\mathrm{H}, Cl-\mathrm{Cl}, CH3-\mathrm{CH_3}, CH2CH3-\mathrm{CH_2CH_3}.

Step 2: Assign CIP priorities.

  1. Cl-\mathrm{Cl}: atomic number 17 (highest priority)
  2. CH2CH3-\mathrm{CH_2CH_3}: the first atom is C, and the next atoms are C, H, H (by expansion: C is bonded to C, H, H)
  3. CH3-\mathrm{CH_3}: the first atom is C, and the next atoms are H, H, H
  4. H-\mathrm{H}: atomic number 1 (lowest priority)

Priority order: Cl>CH2CH3>CH3>H\mathrm{Cl} \gt \mathrm{CH_2CH_3} \gt \mathrm{CH_3} \gt \mathrm{H}

Step 3: Orient the molecule.

Place the lowest priority group (H-\mathrm{H}) pointing away (dashed wedge). If H-\mathrm{H} is on a wedge in the given structure, invert the assignment.

Step 4: Determine R or S.

Looking at the remaining three groups (Cl, ethyl, methyl) in order of decreasing priority: 1231 \to 2 \to 3. If the sequence is clockwise, the configuration is R. If anticlockwise, it is S.

For the standard representation where Cl is on a wedge and H is on a dash: the sequence \mathrm{Cl} \to \mathrm{CH_2CH_3} \to \mathrm{CH_3 goes anticlockwise, so the configuration is S.

If H were on a wedge (pointing toward you), the apparent direction would be reversed, and the true configuration would be R. Always orient H away before assigning.

Worked Example: Drawing the repeating unit of a condensation polymer

Draw the repeating unit of the polyester formed from propane-1,3-diol and butanedioic acid. Write the balanced equation for its formation and identify the by-product.

Solution

Step 1: Write the structures of the monomers.

Propane-1,3-diol: HOCH2CH2CH2OH\mathrm{HOCH_2CH_2CH_2OH}

Butanedioic acid (succinic acid): HOOCCH2CH2COOH\mathrm{HOOCCH_2CH_2COOH}

Step 2: Write the condensation equation.

nHOCH2CH2CH2OH+nHOOCCH2CH2COOH[OCH2CH2CH2OOCCH2CH2CO]n+2nH2On\mathrm{HOCH_2CH_2CH_2OH} + n\mathrm{HOOCCH_2CH_2COOH} \to \left[-\mathrm{OCH_2CH_2CH_2OOCCH_2CH_2CO}-\right]_n + 2n\mathrm{H_2O}

Step 3: Identify the repeating unit.

The repeating unit is: OCH2CH2CH2OOCCH2CH2CO-\mathrm{OCH_2CH_2CH_2OOCCH_2CH_2CO}-

Step 4: Verify atom conservation.

Left side per repeat: C7H12O4\mathrm{C}_7\mathrm{H}_{12}\mathrm{O}_4

Right side per repeat: repeating unit C7H10O4\mathrm{C}_7\mathrm{H}_{10}\mathrm{O}_4 + 2H2O2\mathrm{H_2O} = C7H10O4+H4O2\mathrm{C}_7\mathrm{H}_{10}\mathrm{O}_4 + \mathrm{H_4}\mathrm{O}_2 = C7H14O6\mathrm{C}_7\mathrm{H}_{14}\mathrm{O}_6

Wait --- let me recount. Each repeat consumes one diol (C3H8O2\mathrm{C}_3\mathrm{H}_8\mathrm{O}_2) and one diacid (C4H6O4\mathrm{C}_4\mathrm{H}_6\mathrm{O}_4):

C3H8O2+C4H6O4C7H12O4(repeatingunit)+2H2O\mathrm{C}_3\mathrm{H}_8\mathrm{O}_2 + \mathrm{C}_4\mathrm{H}_6\mathrm{O}_4 \to \mathrm{C}_7\mathrm{H}_{12}\mathrm{O}_4 \mathrm{(repeating unit)} + 2\mathrm{H_2O}

Check atoms: LHS = C7H14O6\mathrm{C}_7\mathrm{H}_{14}\mathrm{O}_6. RHS = C7H12O4+H4O2=C7H16O6\mathrm{C}_7\mathrm{H}_{12}\mathrm{O}_4 + \mathrm{H_4}\mathrm{O}_2 = \mathrm{C}_7\mathrm{H}_{16}\mathrm{O}_6.

That does not balance. The correct stoichiometry is:

C3H8O2+C4H6O4C7H10O4+2H2O\mathrm{C}_3\mathrm{H}_8\mathrm{O}_2 + \mathrm{C}_4\mathrm{H}_6\mathrm{O}_4 \to \mathrm{C}_7\mathrm{H}_{10}\mathrm{O}_4 + 2\mathrm{H_2O}

Check: LHS = C7H14O6\mathrm{C}_7\mathrm{H}_{14}\mathrm{O}_6. RHS = C7H10O4+H4O2=C7H14O6\mathrm{C}_7\mathrm{H}_{10}\mathrm{O}_4 + \mathrm{H_4}\mathrm{O}_2 = \mathrm{C}_7\mathrm{H}_{14}\mathrm{O}_6. Balanced.

The repeating unit has lost 4 H and 2 O relative to the monomers (two ester linkages formed).

Worked Example: Degree of unsaturation and structural elucidation

A compound C8H8O\mathrm{C}_8\mathrm{H}_8\mathrm{O} has the following spectra. IR: 3060cm13060\mathrm{ cm}^{-1} (medium), 1690cm11690\mathrm{ cm}^{-1} (strong), 1600cm11600\mathrm{ cm}^{-1} (medium), 1580cm11580\mathrm{ cm}^{-1} (medium), 750cm1750\mathrm{ cm}^{-1} (strong). 1H^{1}\mathrm{H} NMR: δ 7.5\delta\ 7.5--7.9 (m, 5H)7.9\ (m,\ 5\mathrm{H}), δ 3.9 (s, 2H)\delta\ 3.9\ (s,\ 2\mathrm{H}). MS: M+=120\mathrm{M}^+ = 120. Identify the compound.

Solution

Step 1: Calculate the degree of unsaturation.

DBE=8+182=5\mathrm{DBE} = 8 + 1 - \frac{8}{2} = 5

DBE = 5 is consistent with a benzene ring (DBE = 4) plus one additional unsaturation (likely C=O).

Step 2: Analyse IR data.

  • 3060cm13060\mathrm{ cm}^{-1}: aromatic C--H stretch (above 3000cm13000\mathrm{ cm}^{-1} confirms sp2 C--H).
  • 1690cm11690\mathrm{ cm}^{-1}: C=O stretch (slightly below 17001700, suggesting conjugation with the aromatic ring).
  • 16001600, 1580cm11580\mathrm{ cm}^{-1}: aromatic C=C stretches.
  • 750cm1750\mathrm{ cm}^{-1}: mono-substituted benzene (ortho-disubstituted typically shows near 750cm1750\mathrm{ cm}^{-1}, but combined with other evidence, this suggests a single substituent on the benzene ring).

Step 3: Analyse NMR data.

  • δ 7.5\delta\ 7.5--7.9 (m, 5H)7.9\ (m,\ 5\mathrm{H}): 5 aromatic protons, consistent with a mono-substituted benzene ring (C6H5\mathrm{C}_6\mathrm{H}_5--).
  • δ 3.9 (s, 2H)\delta\ 3.9\ (s,\ 2\mathrm{H}): isolated CH2\mathrm{CH}_2 group, singlet (no adjacent protons). The chemical shift (δ 3.9\delta\ 3.9) suggests the CH2\mathrm{CH}_2 is adjacent to an electron-withdrawing group (C=O).

Step 4: Assemble the structure.

Mono-substituted benzene ring: C6H5\mathrm{C}_6\mathrm{H}_5--. Remaining atoms: C2H3O\mathrm{C}_2\mathrm{H}_3\mathrm{O}. With C=O at 1690cm11690\mathrm{ cm}^{-1} and a CH2\mathrm{CH}_2 singlet at δ 3.9\delta\ 3.9:

Structure: C6H5CH2CHO\mathrm{C}_6\mathrm{H}_5\mathrm{CH_2CHO} (phenylethanal, also called phenylacetaldehyde).

Step 5: Verify.

  • C8H8O\mathrm{C}_8\mathrm{H}_8\mathrm{O}: 8(12)+8(1)+16=120=M+8(12) + 8(1) + 16 = 120 = \mathrm{M}^+. Confirmed.
  • DBE = 5: benzene ring (4) + aldehyde C=O (1). Confirmed.
  • NMR: 5 aromatic H + 2 aldehydic CH2 = 7 H, plus 1 aldehyde H = 8 H total. Confirmed.

The compound is phenylethanal (C6H5CH2CHO\mathrm{C}_6\mathrm{H}_5\mathrm{CH_2CHO}).

Worked Example: Reaction mechanism comparison

For each substrate, predict the major product and mechanism when treated with NaOH\mathrm{NaOH} in H2O\mathrm{H}_2\mathrm{O} at 25°C25\degree\mathrm{C}:

(a) CH3CH2Br\mathrm{CH_3CH_2Br}

(b) (CH3)3CBr(\mathrm{CH_3})_3\mathrm{CBr}

(c) CH3CHBrCH3\mathrm{CH_3CHBrCH_3}

Solution

(a) CH3CH2Br\mathrm{CH_3CH_2Br} (primary substrate, strong nucleophile, polar protic solvent):

Mechanism: SN2 (primary substrates do not form stable carbocations, so SN1/E1 are not possible).

CH3CH2Br+OHCH3CH2OH+Br\mathrm{CH_3CH_2Br + OH^- \to CH_3CH_2OH + Br^-}

Product: ethanol (CH3CH2OH\mathrm{CH_3CH_2OH}). Stereochemistry: Walden inversion at carbon.

(b) (CH3)3CBr(\mathrm{CH_3})_3\mathrm{CBr} (tertiary substrate, strong nucleophile/base, low temperature):

Mechanism: SN1 (tertiary substrates form stable carbocations; back-side attack is blocked for SN2).

Step 1 (slow): (CH3)3CBr(CH3)3C++Br(\mathrm{CH_3})_3\mathrm{CBr} \to (\mathrm{CH_3})_3\mathrm{C}^+ + \mathrm{Br}^-

Step 2 (fast): (CH3)3C++H2O(CH3)3COH2+(\mathrm{CH_3})_3\mathrm{C}^+ + \mathrm{H_2O} \to (\mathrm{CH_3})_3\mathrm{COH_2}^+

Step 3 (fast): (CH3)3COH2+(CH3)3COH+H+(\mathrm{CH_3})_3\mathrm{COH_2}^+ \to (\mathrm{CH_3})_3\mathrm{COH} + \mathrm{H}^+

Product: 2-methylpropan-2-ol (tert-butanol). Minor E1 product: 2-methylpropene.

(c) CH3CHBrCH3\mathrm{CH_3CHBrCH_3} (secondary substrate):

Mechanism: competition between SN1 and SN2. Secondary substrates can proceed via either pathway depending on exact conditions. With NaOH\mathrm{NaOH} in water at 25°C25\degree\mathrm{C}, both SN2 and SN1 are possible, but SN2 is slightly favoured because OH\mathrm{OH}^- is a strong nucleophile.

Product: propan-2-ol (CH3CH(OH)CH3\mathrm{CH_3CH(OH)CH_3}). Minor elimination product: propene.


Common Pitfalls

  • Assuming primary substrates can undergo SN1: Primary carbocations are too unstable to form. A primary alkyl halide with a weak nucleophile and polar protic solvent will still proceed via SN2 (just slowly), not SN1.

  • Confusing stereocentres with chirality: A molecule can have stereocentres but be achiral if it has an internal plane of symmetry (meso compounds). For example, meso-tartaric acid has two stereocentres but is not chiral overall.

  • Writing the monomer instead of the repeating unit: The repeating unit of an addition polymer is not the same as the monomer --- the double bond has opened. For polyethene, the monomer is CH2=CH2\mathrm{CH_2=CH_2} but the repeating unit is CH2CH2-\mathrm{CH_2CH_2}-.

  • Using the wrong pKa\mathrm{p}K_a when working with bases: In the Henderson-Hasselbalch equation, always use the pKa\mathrm{p}K_a of the conjugate acid, not the pKb\mathrm{p}K_b of the base. pKa+pKb=14.00\mathrm{p}K_a + \mathrm{p}K_b = 14.00.

  • Ignoring conjugation effects on IR frequencies: A C=O conjugated with a C=C bond absorbs at a lower wavenumber (1680cm1\sim 1680\mathrm{ cm}^{-1}) than an unconjugated C=O (1715cm1\sim 1715\mathrm{ cm}^{-1}). This shift is diagnostic in structure determination.

  • Misassigning NMR splitting patterns: The n+1n + 1 rule only applies when the neighbouring protons are equivalent. Non-equivalent neighbouring protons produce complex multiplets, not simple doublets or triplets.

  • Forgetting that E2 requires an anti-periplanar arrangement: The proton being removed and the leaving group must be in the same plane on opposite sides. This geometric requirement can make certain E2 eliminations stereospecific and can explain why some theoretical elimination products are not observed.

  • Confusing addition and condensation polymerisation mechanisms: Addition polymers form from alkene monomers with no by-product. Condensation polymers form from monomers with two functional groups and release a small molecule (usually H2O\mathrm{H}_2\mathrm{O} or HCl\mathrm{HCl}).

  • Over-relying on DBE alone for structural identification: DBE = 4 suggests an aromatic ring but does not prove it. A compound could have two C=C bonds and two rings. Always confirm with IR and NMR data.


Exam-Style Problems

  1. Predict the major organic product(s) and state the mechanism for each reaction: (a) CH3CH2CH2Br\mathrm{CH_3CH_2CH_2Br} with NaOH\mathrm{NaOH} in H2O\mathrm{H}_2\mathrm{O} at 25°C25\degree\mathrm{C} (b) (CH3)3CBr\mathrm{(CH_3)_3CBr} with NaOH\mathrm{NaOH} in ethanol at 80°C80\degree\mathrm{C} (c) CH3CHBrCH3\mathrm{CH_3CHBrCH_3} with NaOH\mathrm{NaOH} in ethanol at 25°C25\degree\mathrm{C} [Medium]

  2. A compound C4H8O\mathrm{C}_4\mathrm{H}_8\mathrm{O} shows IR absorptions at 1720cm11720\mathrm{ cm}^{-1} (strong) and 2720cm12720\mathrm{ cm}^{-1} (weak). 1H^{1}\mathrm{H} NMR: δ 1.2 (d, 3H)\delta\ 1.2\ (d,\ 3\mathrm{H}), δ 2.5 (q, 1H)\delta\ 2.5\ (q,\ 1\mathrm{H}), δ 9.7 (d, 1H)\delta\ 9.7\ (d,\ 1\mathrm{H}). Identify the compound and explain the splitting pattern of the signal at δ 9.7\delta\ 9.7. [Medium]

  3. Draw the repeating unit of the polyamide formed from hexane-1,6-diamine and pentanedioic acid. Write the balanced equation. Calculate the mass of polymer produced from 10.0g10.0\mathrm{ g} of each monomer, assuming 100% yield. [Medium]

  4. Explain why 2-bromobutane reacts with NaOH\mathrm{NaOH} in ethanol to produce a mixture of butan-2-ol and but-2-ene, but 2-bromo-2-methylpropane reacts under the same conditions to produce predominantly 2-methylpropene. Reference the relevant mechanisms in your answer. [Hard]

  5. A compound C9H10O\mathrm{C}_9\mathrm{H}_{10}\mathrm{O} has the following spectra. IR: 3050cm13050\mathrm{ cm}^{-1}, 1700cm11700\mathrm{ cm}^{-1}, 16001600, 15801580, 1470cm11470\mathrm{ cm}^{-1}, 690cm1690\mathrm{ cm}^{-1}. 1H^{1}\mathrm{H} NMR: δ 2.6 (s, 3H)\delta\ 2.6\ (s,\ 3\mathrm{H}), δ 7.5\delta\ 7.5--8.0 (m, 5H)8.0\ (m,\ 5\mathrm{H}), δ 9.9 (s, 2H)\delta\ 9.9\ (s,\ 2\mathrm{H}). MS: M+=134\mathrm{M}^+ = 134. Identify the compound. [Hard]

  6. (a) Assign the CIP priority to each group on the stereocentre of 3-bromopentan-2-ol. (b) Determine the absolute configuration. (c) Draw both enantiomers and label them R and S. (d) Would a racemic mixture of this compound be optically active? [Medium]

  7. Compare and contrast the structures and properties of low-density polyethene (LDPE) and high-density polyethene (HDPE). Reference the branching of polymer chains, intermolecular forces, density, melting point, and typical applications. [Medium]

  8. Deduce the structure of a compound C7H14O\mathrm{C}_7\mathrm{H}_{14}\mathrm{O} given: IR: 3400cm13400\mathrm{ cm}^{-1} (broad), 2950cm12950\mathrm{ cm}^{-1} (sharp), no C=O absorption. 1H^{1}\mathrm{H} NMR: δ 0.9 (t, 6H)\delta\ 0.9\ (t,\ 6\mathrm{H}), δ 1.4 (m, 4H)\delta\ 1.4\ (m,\ 4\mathrm{H}), δ 1.6 (s, 2H)\delta\ 1.6\ (s,\ 2\mathrm{H}), δ 2.4 (t, 2H)\delta\ 2.4\ (t,\ 2\mathrm{H}). The signal at δ 1.6\delta\ 1.6 disappears upon D2O\mathrm{D}_2\mathrm{O} addition. [Hard]


If You Get These Wrong, Revise: