Example — Nylon-6,6 Monomers: hexane-1,6-diamine and hexanedioic acid.
NH2N(CH2)6NH2+nHOOC(CH2)4COOH→Nylon−6,6+2nH2OUses: textiles, ropes, parachutes, engineering plastics.
An aromatic polyamide (aramid) with exceptional strength:
benzene−1,4−diamine+benzene−1,4−dicarboxylicacid→KevlarThe rigid aromatic rings and strong hydrogen bonding between chains give Kevlar its high tensile Strength. Used in body armour, tyres, and aerospace.
| Property | Addition polymer | Condensation polymer |
|---|
| Monomers | Alkenes | Diols + diacids / diamines + diacids |
| By-product | None | H2O or HCl |
| Biodegradability | Generally non-biodegradable | Some are biodegradable |
| Bond type | C—C backbone | Contains ester or amide bonds |
| Examples | PE, PP, PVC, PTFE | PET, Nylon, Kevlar |
- Calculate the degree of unsaturation (double bond equivalents, DBE):
DBE=C+1−2H+2N(For each halogen, add 1 to H. For each oxygen, ignore.)
IR spectroscopy: identify functional groups from characteristic absorptions.
1H NMR: determine proton environments, integration, and splitting.
Mass spectrometry: determine molecular mass and fragmentation pattern.
Assemble all fragments into a consistent structure.
| Molecular formula | DBE | Possible features |
|---|
| C4H10 | 0 | No double bonds, no rings (alkane) |
| C4H8 | 1 | One double bond or one ring |
| C4H6 | 2 | Two double bonds, one triple, or two rings |
| C6H6 | 4 | Benzene ring (three double bonds + ring) |
| Bond | Range (cm−1) |
|---|
| O—H (acid) | 2500—3300 (very broad) |
| O—H (alcohol) | 3200—3600 (broad) |
| N—H | 3300—3500 |
| C—H (alkane) | 2850—3000 |
| C—H (alkene) | 3000—3100 |
| C≡N | 2200—2250 |
| C=O | 1700—1750 |
| C=C | 1600—1680 |
| Proton type | δ (ppm) |
|---|
| Alkane | 0.7—1.5 |
| Adjacent to C=O | 2.0—2.7 |
| Alkene | 4.5—6.5 |
| Aromatic | 6.5—8.0 |
| Aldehyde | 9.0—10.0 |
| Carboxylic acid | 10.0—12.0 |
- DBE = 4 is a strong indicator of a benzene ring, but not …/1-number-and-algebra/3_proof-and-logic by itself.
- In 1H NMR, the integration ratio must be multiplied by the total number of protons (determined from the molecular formula).
- D2O exchange removes OH and NH signals, confirming their presence.
Problem 1
For each substrate, predict whether SN1, SN2, E1, or E2 will be the major pathway:
(a) CH3CH2Br with NaOH in H2O at 25°C
(b) (CH3)3CBr with NaOH in ethanol at 80°C
(c) (CH3)3CBr with H2O at 25°C
Solution:
(a) SN2: primary substrate, strong nucleophile/base, polar protic solvent, low temperature.
(b) E2: tertiary substrate, strong base, high temperature favours elimination over substitution.
(c) SN1: tertiary substrate, weak nucleophile (water), polar protic solvent, low temperature. The carbocation intermediate is stable.
Problem 2
An unknown compound has molecular formula C3H6O2. Its IR spectrum Shows a broad peak at 3000cm−1 and a strong peak at 1710cm−1. Its 1H NMR spectrum shows: δ 1.2 (d, 3H) δ 4.1 (q, 1H), δ 11.0 (s, 1H) And a singlet at δ 2.0 That integrates to 1H.
Wait — the formula only has 6 H. Let me correct: δ 1.2 (d, 3H) δ 2.5 (q, 2H), δ 11.5 (s, 1H). Identify the compound.
Solution:
- C3H6O2: DBE=3+1−6/2=1 (one C=O).
- IR: broad 3000cm−1 (O—H) + 1710cm−1 (C=O) = carboxylic acid.
- NMR: d,3H + q,2H = ethyl group (CH3CH2—). s,1H = COOH proton.
- Structure: CH3CH2COOH (propanoic acid).
Check: M = 3(12)+6(1)+2(16)=74. But C3H6O2 has M = 74. Confirmed.
Problem 3
Draw the repeating unit of the polyester formed from propane-1,3-diol and butanedioic acid. Write The equation for its formation.
Solution:
NHOCH2CH2CH2OH+nHOOCCH2CH2COOH→[−OCH2CH2CH2OOCCH2CH2CO−]n+2nH2ORepeating unit: −OCH2CH2CH2OOCCH2CH2CO−
Problem 4
A compound C5H10O shows the following spectra. IR: strong peak at 1700cm−1No broad O—H. 1H NMR: δ 1.0 (t, 3H) δ 1.6 (m, 2H), δ 2.1 (s, 3H) δ 2.3 (t, 2H). Identify the compound.
Solution:
- C5H10O: DBE=5+1−10/2=1 (one C=O).
- IR: 1700cm−1 (C=O), no O—H = ketone or aldehyde. No aldehyde peak around δ 9—10 So it is a ketone.
- NMR: triplet + multiplet + triplet = propyl chain (CH3CH2CH2—). Singlet at δ 2.1 (3H) = CH3CO—.
- Structure: \mathrm{CH_3COCH_2CH_2CH_3 (pentan-2-one).
Total protons: 3+2+3+2=10=C5H10O. Confirmed.
Worked Example: Predicting the major organic product of a substitution reaction
Predict the major product when (CH3)3CBr is heated with KOH in ethanol. State the Mechanism, draw the transition state or intermediate, and explain the regiochemistry.
Solution
Substrate analysis: (CH3)3CBr is a tertiary alkyl halide.
Conditions: KOH (strong base) in ethanol (polar protic solvent) at elevated temperature.
Mechanism determination: Tertiary substrate + strong base + heat → E2 is favoured over SN2. SN1 is also possible but elevated temperature shifts the product distribution toward elimination.
Major product: E2 elimination.
The base abstracts a proton from a β-carbon while the leaving group departs. By Zaitsev’s Rule, the more substituted (more stable) alkene is the major product:
(CH3)3CBr+KOH→(CH3)2C=CH2+KBr+H2O
This is the Hofmann product (less substituted). The Zaitsev product would require removing a Proton from a methyl group:
(CH3)3CBr+KOH→CH3CH=C(CH3)2+KBr+H2O
Actually, for (CH3)3CBrThere are no β-hydrogens on the carbon bearing two methyl groups That are distinct from the terminal methyl groups. The only elimination products are (CH3)2C=CH2 (the only possible alkene). Since there is only one type of β-hydrogen, Zaitsev’s rule does not apply here --- there is only one elimination product.
SN1 product (minor): (CH3)3COH (tert-butanol), formed via a carbocation intermediate with Water as the nucleophile.
Worked Example: CIP priority rules and R/S assignment
Assign the absolute configuration (R or S) to the stereocentre in CH3CHClCH2CH3 (2-chlorobutane).
Solution
Step 1: Identify the stereocentre.
Carbon-2 is bonded to four different groups: -\mathrm{H}$$-\mathrm{Cl}$$-\mathrm{CH_3} −CH2CH3.
Step 2: Assign CIP priorities.
- −Cl: atomic number 17 (highest priority)
- −CH2CH3: the first atom is C, and the next atoms are C, H, H (by expansion: C is bonded to C, H, H)
- −CH3: the first atom is C, and the next atoms are H, H, H
- −H: atomic number 1 (lowest priority)
Priority order: Cl>CH2CH3>CH3>H
Step 3: Orient the molecule.
Place the lowest priority group (−H) pointing away (dashed wedge). If −H is On a wedge in the given structure, invert the assignment.
Step 4: Determine R or S.
Looking at the remaining three groups (Cl, ethyl, methyl) in order of decreasing priority: 1→2→3. If the sequence is clockwise, the configuration is R. If anticlockwise, it is S.
For the standard representation where Cl is on a wedge and H is on a dash: the sequence \mathrm{Cl} \to \mathrm{CH_2CH_3} \to \mathrm{CH_3 goes anticlockwise, so the configuration is S.
If H were on a wedge (pointing toward you), the apparent direction would be reversed, and the true Configuration would be R. Always orient H away before assigning.
Worked Example: Drawing the repeating unit of a condensation polymer
Draw the repeating unit of the polyester formed from propane-1,3-diol and butanedioic acid. Write The balanced equation for its formation and identify the by-product.
Solution
Step 1: Write the structures of the monomers.
Propane-1,3-diol: HOCH2CH2CH2OH
Butanedioic acid (succinic acid): HOOCCH2CH2COOH
Step 2: Write the condensation equation.
nHOCH2CH2CH2OH+nHOOCCH2CH2COOH→[−OCH2CH2CH2OOCCH2CH2CO−]n+2nH2O
Step 3: Identify the repeating unit.
The repeating unit is: −OCH2CH2CH2OOCCH2CH2CO−
Step 4: Verify atom conservation.
Left side per repeat: C7H12O4
Right side per repeat: repeating unit C7H10O4 + 2H2O = C7H10O4+H4O2 = C7H14O6
Wait --- let me recount. Each repeat consumes one diol (C3H8O2) And one diacid (C4H6O4):
C3H8O2+C4H6O4→C7H12O4(repeatingunit)+2H2O
Check atoms: LHS = C7H14O6. RHS = C7H12O4+H4O2=C7H16O6.
That does not balance. The correct stoichiometry is:
C3H8O2+C4H6O4→C7H10O4+2H2O
Check: LHS = C7H14O6. RHS = C7H10O4+H4O2=C7H14O6. Balanced.
The repeating unit has lost 4 H and 2 O relative to the monomers (two ester linkages formed).
Worked Example: Degree of unsaturation and structural elucidation
A compound C8H8O has the following spectra. IR: 3060cm−1 (medium), 1690cm−1 (strong), 1600cm−1 (medium), 1580cm−1 (medium), 750cm−1 (strong). 1H NMR: δ 7.5—7.9 (m, 5H), δ 3.9 (s, 2H). MS: M+=120. Identify the compound.
Solution
Step 1: Calculate the degree of unsaturation.
DBE=8+1−28=5
DBE = 5 is consistent with a benzene ring (DBE = 4) plus one additional unsaturation (likely C=O).
Step 2: Analyse IR data.
- 3060cm−1: aromatic C—H stretch (above 3000cm−1 confirms sp2 C—H).
- 1690cm−1: C=O stretch (slightly below 1700Suggesting conjugation with the aromatic ring).
- 1600, 1580cm−1: aromatic C=C stretches.
- 750cm−1: mono-substituted benzene (ortho-disubstituted shows near 750cm−1 But combined with other evidence, this suggests a single substituent on the benzene ring).
Step 3: Analyse NMR data.
- δ 7.5—7.9 (m, 5H): 5 aromatic protons, consistent with a mono-substituted benzene ring (C6H5—).
- δ 3.9 (s, 2H): isolated CH2 group, singlet (no adjacent protons). The chemical shift (δ 3.9) suggests the CH2 is adjacent to an electron-withdrawing group (C=O).
Step 4: Assemble the structure.
Mono-substituted benzene ring: C6H5—. Remaining atoms: C2H3O. With C=O at 1690cm−1 and a CH2 singlet at δ 3.9:
Structure: C6H5CH2CHO (phenylethanal, also called phenylacetaldehyde).
Step 5: Verify.
- C8H8O: 8(12)+8(1)+16=120=M+. Confirmed.
- DBE = 5: benzene ring (4) + aldehyde C=O (1). Confirmed.
- NMR: 5 aromatic H + 2 aldehydic CH2 = 7 H, plus 1 aldehyde H = 8 H total. Confirmed.
The compound is phenylethanal (C6H5CH2CHO).
Worked Example: Reaction mechanism comparison
For each substrate, predict the major product and mechanism when treated with NaOH in H2O at 25°C:
(a) CH3CH2Br
(b) (CH3)3CBr
(c) CH3CHBrCH3
Solution
(a) CH3CH2Br (primary substrate, strong nucleophile, polar protic solvent):
Mechanism: SN2 (primary substrates do not form stable carbocations, so SN1/E1 are not possible).
CH3CH2Br+OH−→CH3CH2OH+Br−
Product: ethanol (CH3CH2OH). Stereochemistry: Walden inversion at carbon.
(b) (CH3)3CBr (tertiary substrate, strong nucleophile/base, low temperature):
Mechanism: SN1 (tertiary substrates form stable carbocations; back-side attack is blocked for SN2).
Step 1 (slow): (CH3)3CBr→(CH3)3C++Br−
Step 2 (fast): (CH3)3C++H2O→(CH3)3COH2+
Step 3 (fast): (CH3)3COH2+→(CH3)3COH+H+
Product: 2-methylpropan-2-ol (tert-butanol). Minor E1 product: 2-methylpropene.
(c) CH3CHBrCH3 (secondary substrate):
Mechanism: competition between SN1 and SN2. Secondary substrates can proceed via either pathway Depending on exact conditions. With NaOH in water at 25°CBoth SN2 and SN1 are possible, but SN2 is slightly favoured because OH− is a strong nucleophile.
Product: propan-2-ol (CH3CH(OH)CH3). Minor elimination product: propene.
Assuming primary substrates can undergo SN1: Primary carbocations are too unstable to form. A primary alkyl halide with a weak nucleophile and polar protic solvent will still proceed via SN2 (just slowly), not SN1.
Confusing stereocentres with chirality: A molecule can have stereocentres but be achiral if it has an internal plane of symmetry (meso compounds). For example, meso-tartaric acid has two stereocentres but is not chiral overall.
Writing the monomer instead of the repeating unit: The repeating unit of an addition polymer is not the same as the monomer --- the double bond has opened. For polyethene, the monomer is CH2=CH2 but the repeating unit is −CH2CH2−.
Using the wrong pKa when working with bases: In the Henderson-Hasselbalch equation, always use the pKa of the conjugate acid, not the pKb of the base. pKa+pKb=14.00.
Ignoring conjugation effects on IR frequencies: A C=O conjugated with a C=C bond absorbs at a lower wavenumber (∼1680cm−1) than an unconjugated C=O (∼1715cm−1). This shift is diagnostic in structure determination.
Misassigning NMR splitting patterns: The n+1 rule only applies when the neighbouring protons are equivalent. Non-equivalent neighbouring protons produce complex multiplets, not simple doublets or triplets.
Forgetting that E2 requires an anti-periplanar arrangement: The proton being removed and the leaving group must be in the same plane on opposite sides. This geometric requirement can make certain E2 eliminations stereospecific and can explain why some theoretical elimination products are not observed.
Confusing addition and condensation polymerisation mechanisms: Addition polymers form from alkene monomers with no by-product. Condensation polymers form from monomers with two functional groups and release a small molecule ( H2O or HCl).
Over-relying on DBE alone for structural identification: DBE = 4 suggests an aromatic ring but does not prove it. A compound could have two C=C bonds and two rings. Always confirm with IR and NMR data.
Predict the major organic product(s) and state the mechanism for each reaction: (a) CH3CH2CH2Br with NaOH in H2O at 25°C (b) (CH3)3CBr with NaOH in ethanol at 80°C (c) CH3CHBrCH3 with NaOH in ethanol at 25°C [Medium]
A compound C4H8O shows IR absorptions at 1720cm−1 (strong) and 2720cm−1 (weak). 1H NMR: δ 1.2 (d, 3H), δ 2.5 (q, 1H) δ 9.7 (d, 1H). Identify the compound and explain the splitting pattern of the signal at δ 9.7. [Medium]
Draw the repeating unit of the polyamide formed from hexane-1,6-diamine and pentanedioic acid. Write the balanced equation. Calculate the mass of polymer produced from 10.0g of each monomer, assuming 100% yield. [Medium]
Explain why 2-bromobutane reacts with NaOH in ethanol to produce a mixture of butan-2-ol and but-2-ene, but 2-bromo-2-methylpropane reacts under the same conditions to produce predominantly 2-methylpropene. Reference the relevant mechanisms in your answer. [Hard]
A compound C9H10O has the following spectra. IR: 3050\mathrm{ cm}^{-1}$$1700\mathrm{ cm}^{-1}$$1600$$1580$$1470\mathrm{ cm}^{-1} 690cm−1. 1H NMR: δ 2.6 (s, 3H) δ 7.5—8.0\ (m,\ 5\mathrm{H})$$\delta\ 9.9\ (s,\ 2\mathrm{H}). MS: M+=134. Identify the compound. [Hard]
(a) Assign the CIP priority to each group on the stereocentre of 3-bromopentan-2-ol. (b) Determine the absolute configuration. (c) Draw both enantiomers and label them R and S. (d) Would a racemic mixture of this compound be optically active? [Medium]
Compare and contrast the structures and properties of low-density polyethene (LDPE) and high-density polyethene (HDPE). Reference the branching of polymer chains, intermolecular forces, density, melting point, and typical applications. [Medium]
Deduce the structure of a compound C7H14O given: IR: 3400cm−1 (broad), 2950cm−1 (sharp), no C=O absorption. 1H NMR: \delta\ 0.9\ (t,\ 6\mathrm{H})$$\delta\ 1.4\ (m,\ 4\mathrm{H}) \delta\ 1.6\ (s,\ 2\mathrm{H})$$\delta\ 2.4\ (t,\ 2\mathrm{H}). The signal at δ 1.6 disappears upon D2O addition. [Hard]
flowchart TD
A[2_Organic Chemistry Advanced] --> B[Key Concepts]
A --> C[Core Principles]
A --> D[Practical Applications]
B --> E[Fundamental definitions]
C --> F[Design patterns]
D --> G[Real-world usage]This topic covers the essential chemistry of organic chemistry (advanced), including key reactions, underlying theories, and practical applications.
Key concepts include:
- homologous series and functional groups
- nomenclature (IUPAC)
- reaction mechanisms (SN1, SN2, electrophilic addition)
- stereochemistry and chirality
- spectroscopy (IR, NMR, mass spec)
Mastery of these concepts requires both theoretical understanding and the ability to apply knowledge to unfamiliar contexts, particularly in calculation and practical questions.
| Topic | Site | Link |
|---|
| [Advanced Organic Chemistry] | IB | View |
| [Advanced Organic Chemistry] | DSE | View |